missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Methoxybenzophenone, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 125740250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 4-Methoxybenzophenone | |
| 611-94-9 | |
| 100.0 | |
| Authentic | |
| Glass bottle | |
| CH3OC6H4COC6H5 | |
| 25g | |
| 4-methoxybenzophenone, 4-methoxyphenyl phenyl methanone, p-methoxybenzophenone, benzophenone, 4-methoxy, methanone, 4-methoxyphenyl phenyl, phenyl p-anisyl ketone, 4-benzoylanisole, 4-methoxyphenyl phenylmethanone, unii-i4xj07373m, 4-methoxyphenyl-phenylmethanone | |
| SWFHGTMLYIBPPA-UHFFFAOYSA-N | |
| (4-methoxyphenyl)-phenylmethanone | |
| 69146 | |
| 97% |
| 97% | |
| 96.0 | |
| 354°C to 356°C | |
| 96% min. (GC) | |
| C14H12O2 | |
| MFCD00008403 | |
| 08, 159 | |
| Solubility in water: insoluble in water. Other solubilities: soluble in ethanol and ether | |
| COC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 | |
| 212.25 | |
| 212.25 |
Chemical Identifiers
| 611-94-9 | |
| 212.25 | |
| SWFHGTMLYIBPPA-UHFFFAOYSA-N | |
| 69146 | |
| COC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| C14H12O2 | |
| MFCD00008403 | |
| 4-methoxybenzophenone, 4-methoxyphenyl phenyl methanone, p-methoxybenzophenone, benzophenone, 4-methoxy, methanone, 4-methoxyphenyl phenyl, phenyl p-anisyl ketone, 4-benzoylanisole, 4-methoxyphenyl phenylmethanone, unii-i4xj07373m, 4-methoxyphenyl-phenylmethanone | |
| (4-methoxyphenyl)-phenylmethanone |
Safety and Handling
EINECSNumber : 210-285-5
RTECSNumber : PC4962500
RUO â Research Use Only