missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Chloronitrobenzene 98.0+%, TCI America™
$26.54 - $49.78
Chemical Identifiers
| CAS | 100-00-5 |
|---|---|
| Molecular Formula | C6H4ClNO2 |
| Molecular Weight (g/mol) | 157.553 |
| MDL Number | MFCD00007285 |
| InChI Key | CZGCEKJOLUNIFY-UHFFFAOYSA-N |
| Synonym | 4-chloronitrobenzene, p-chloronitrobenzene, p-nitrochlorobenzene, benzene, 1-chloro-4-nitro, 4-nitrochlorobenzene, pncb, 4-chloro-1-nitrobenzene, p-nitrophenyl chloride, p-nitrochlorobenzol, p-nitroclorobenzene |
| PubChem CID | 7474 |
| ChEBI | CHEBI:34399 |
| IUPAC Name | 1-chloro-4-nitrobenzene |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])Cl |
Chemical Identifiers
| 100-00-5 | |
| 157.553 | |
| CZGCEKJOLUNIFY-UHFFFAOYSA-N | |
| 7474 | |
| 1-chloro-4-nitrobenzene |
| C6H4ClNO2 | |
| MFCD00007285 | |
| 4-chloronitrobenzene, p-chloronitrobenzene, p-nitrochlorobenzene, benzene, 1-chloro-4-nitro, 4-nitrochlorobenzene, pncb, 4-chloro-1-nitrobenzene, p-nitrophenyl chloride, p-nitrochlorobenzol, p-nitroclorobenzene | |
| CHEBI:34399 | |
| C1=CC(=CC=C1[N+](=O)[O-])Cl |
Specifications
| 100-00-5 | |
| 242°C | |
| MFCD00007285 | |
| 1578 | |
| CZGCEKJOLUNIFY-UHFFFAOYSA-N | |
| 1-chloro-4-nitrobenzene | |
| 7474 | |
| 157.55 | |
| Crystalline Powder |
| 84°C | |
| C6H4ClNO2 | |
| 25 g | |
| 4-chloronitrobenzene, p-chloronitrobenzene, p-nitrochlorobenzene, benzene, 1-chloro-4-nitro, 4-nitrochlorobenzene, pncb, 4-chloro-1-nitrobenzene, p-nitrophenyl chloride, p-nitrochlorobenzol, p-nitroclorobenzene | |
| C1=CC(=CC=C1[N+](=O)[O-])Cl | |
| 157.553 | |
| CHEBI:34399 | |
| ≥98.0% (GC) | |
| 4-Chloronitrobenzene |
Safety and Handling
EINECSNumber : (3)-0442
RTECSNumber : CZ1050000
TSCA : Yes