missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Butylbenzene-1-sulfonyl chloride, 97%, Thermo Scientific™
Chemical Identifiers
| CAS | 54997-92-1 |
|---|---|
| Molecular Formula | C10H13ClO2S |
| Molecular Weight (g/mol) | 232.72 |
| MDL Number | MFCD00173908 |
| InChI Key | OVFZELSNOHIDEF-UHFFFAOYSA-N |
| Synonym | 4-butylbenzene-1-sulfonyl chloride, 4-n-butylbenzenesulfonyl chloride, 4-n-butyl benzenesulphonyl chloride, 4-butyl-benzenesulfonyl chloride, 4-n-butylphenylsulfonyl chloride, 4-n-butylbenzenesulphonyl chloride, benzenesulfonyl chloride, 4-butyl, 4-butylphenyl chlorosulfone, pubchem5484, 4-n-butylbenzenesulfonylchloride |
| PubChem CID | 2737352 |
| IUPAC Name | 4-butylbenzene-1-sulfonyl chloride |
| SMILES | CCCCC1=CC=C(C=C1)S(Cl)(=O)=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity & Availability | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity & Availability | |||||
|
BTB10243EB
|
N/A | 25g |
N/A
|
N/A | |||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 54997-92-1 | |
| 232.72 | |
| OVFZELSNOHIDEF-UHFFFAOYSA-N | |
| 2737352 | |
| CCCCC1=CC=C(C=C1)S(Cl)(=O)=O |
| C10H13ClO2S | |
| MFCD00173908 | |
| 4-butylbenzene-1-sulfonyl chloride, 4-n-butylbenzenesulfonyl chloride, 4-n-butyl benzenesulphonyl chloride, 4-butyl-benzenesulfonyl chloride, 4-n-butylphenylsulfonyl chloride, 4-n-butylbenzenesulphonyl chloride, benzenesulfonyl chloride, 4-butyl, 4-butylphenyl chlorosulfone, pubchem5484, 4-n-butylbenzenesulfonylchloride | |
| 4-butylbenzene-1-sulfonyl chloride |
Specifications
| 54997-92-1 | |
| 100.0 | |
| C10H13ClO2S | |
| MFCD00173908 | |
| OVFZELSNOHIDEF-UHFFFAOYSA-N | |
| 4-butylbenzene-1-sulfonyl chloride | |
| 2737352 | |
| 97% |
| 96.5 | |
| 97% | |
| CH3(CH2)3C6H4SO2Cl | |
| 4-butylbenzene-1-sulfonyl chloride, 4-n-butylbenzenesulfonyl chloride, 4-n-butyl benzenesulphonyl chloride, 4-butyl-benzenesulfonyl chloride, 4-n-butylphenylsulfonyl chloride, 4-n-butylbenzenesulphonyl chloride, benzenesulfonyl chloride, 4-butyl, 4-butylphenyl chlorosulfone, pubchem5484, 4-n-butylbenzenesulfonylchloride | |
| CCCCC1=CC=C(C=C1)S(Cl)(=O)=O | |
| 232.72 | |
| 232.73 | |
| 4-Butylbenzene-1-sulfonyl chloride |
Safety and Handling
GHS P Statement Causes severe skin burns and eye damage. Contact with water liberates toxic gas. Reacts violently with water.
GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Immediately call a POISON CENTER or doctor/physician. IF IN EYES: Rinse cau
Danger