missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Butylbenzene-1-sulfonyl chloride, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals BTB10243EB
| Quantity | 25g |
|---|
Chemical Identifiers
| 54997-92-1 | |
| 232.72 | |
| OVFZELSNOHIDEF-UHFFFAOYSA-N | |
| 2737352 | |
| CCCCC1=CC=C(C=C1)S(Cl)(=O)=O |
| C10H13ClO2S | |
| MFCD00173908 | |
| 4-butylbenzene-1-sulfonyl chloride, 4-n-butylbenzenesulfonyl chloride, 4-n-butyl benzenesulphonyl chloride, 4-butyl-benzenesulfonyl chloride, 4-n-butylphenylsulfonyl chloride, 4-n-butylbenzenesulphonyl chloride, benzenesulfonyl chloride, 4-butyl, 4-butylphenyl chlorosulfone, pubchem5484, 4-n-butylbenzenesulfonylchloride | |
| 4-butylbenzene-1-sulfonyl chloride |
Specifications
| 4-Butylbenzene-1-sulfonyl chloride | |
| 96.5 | |
| 97% | |
| CH3(CH2)3C6H4SO2Cl | |
| MFCD00173908 | |
| OVFZELSNOHIDEF-UHFFFAOYSA-N | |
| 4-butylbenzene-1-sulfonyl chloride | |
| 2737352 | |
| 97% |
| 54997-92-1 | |
| 100.0 | |
| C10H13ClO2S | |
| 25g | |
| 4-butylbenzene-1-sulfonyl chloride, 4-n-butylbenzenesulfonyl chloride, 4-n-butyl benzenesulphonyl chloride, 4-butyl-benzenesulfonyl chloride, 4-n-butylphenylsulfonyl chloride, 4-n-butylbenzenesulphonyl chloride, benzenesulfonyl chloride, 4-butyl, 4-butylphenyl chlorosulfone, pubchem5484, 4-n-butylbenzenesulfonylchloride | |
| CCCCC1=CC=C(C=C1)S(Cl)(=O)=O | |
| 232.72 | |
| 232.73 |
Safety and Handling
GHS P Statement Causes severe skin burns and eye damage. Contact with water liberates toxic gas. Reacts violently with water.
GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Immediately call a POISON CENTER or doctor/physician. IF IN EYES: Rinse cau
Danger