Learn More
4-Bromomethylbenzenesulfonyl chloride, 95%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 360540050
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 4-Bromomethylbenzenesulfonyl chloride | |
| 94.0 | |
| Authentic | |
| Glass bottle | |
| BrCH2C6H4SO2Cl | |
| 5g | |
| QXTQWYZHHMQSQH-UHFFFAOYSA-N | |
| 4-(bromomethyl)benzenesulfonyl chloride | |
| 2734409 | |
| 95% |
| 66176-39-4 | |
| 100.0 | |
| 94% min. (Argentometry) | |
| C7H6BrClO2S | |
| MFCD00156129 | |
| 4-bromomethyl benzenesulfonyl chloride, 4-bromomethyl benzene-1-sulfonyl chloride, 4-bromomethyl benzenesulfonylchloride, alpha-bromo-p-toluenesulphonyl chloride, alpha-bromo-p-toluenesulfonyl chloride, 4-bromomethyl benzenesulphonyl chloride, 4-bromomethyl benzene-1-sulfonylchloride, buttpark 94\04-08, 4-bromomethyl phenyl chlorosulfone, 4-bromomethylene benzenesulfonyl chloride | |
| C1=CC(=CC=C1CBr)S(=O)(=O)Cl | |
| 269.55 | |
| 269.55 |
Chemical Identifiers
| 66176-39-4 | |
| 269.55 | |
| QXTQWYZHHMQSQH-UHFFFAOYSA-N | |
| 2734409 | |
| C1=CC(=CC=C1CBr)S(=O)(=O)Cl |
| C7H6BrClO2S | |
| MFCD00156129 | |
| 4-bromomethyl benzenesulfonyl chloride, 4-bromomethyl benzene-1-sulfonyl chloride, 4-bromomethyl benzenesulfonylchloride, alpha-bromo-p-toluenesulphonyl chloride, alpha-bromo-p-toluenesulfonyl chloride, 4-bromomethyl benzenesulphonyl chloride, 4-bromomethyl benzene-1-sulfonylchloride, buttpark 94\04-08, 4-bromomethyl phenyl chlorosulfone, 4-bromomethylene benzenesulfonyl chloride | |
| 4-(bromomethyl)benzenesulfonyl chloride |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
Wear protective gloves/protective clothing/eye protection/face protection.
Immediately
GHS Signal Word: Danger
RUO â Research Use Only