missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Bromodiphenyl ether, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 106890250
Specifications
| 4-Bromodiphenyl ether | |
| 1.4230g/mL | |
| >113°C | |
| Glass bottle | |
| 1.6081 | |
| 25g | |
| 1.423 | |
| JDUYPUMQALQRCN-UHFFFAOYSA-N | |
| 1-bromo-4-phenoxybenzene | |
| 7565 | |
| 249.11 |
| 101-55-3 | |
| 305.0°C | |
| 98.5% min. (GC) | |
| C12H9BrO | |
| BrC6H4OC6H5 | |
| 06,I,105 | |
| 4-bromodiphenyl ether, 4-bromophenyl phenyl ether, 4-bromophenoxybenzene, p-bromodiphenyl ether, p-phenoxybromobenzene, benzene, 1-bromo-4-phenoxy, p-bromophenyl phenyl ether, 4-bromodiphenylether, p-bromophenoxybenzene, ether, p-bromophenyl phenyl | |
| C1=CC=C(C=C1)OC2=CC=C(C=C2)Br | |
| 249.11 | |
| CHEBI:77421 | |
| 99% |
Chemical Identifiers
| 101-55-3 | |
| 249.11 | |
| 4-bromodiphenyl ether, 4-bromophenyl phenyl ether, 4-bromophenoxybenzene, p-bromodiphenyl ether, p-phenoxybromobenzene, benzene, 1-bromo-4-phenoxy, p-bromophenyl phenyl ether, 4-bromodiphenylether, p-bromophenoxybenzene, ether, p-bromophenyl phenyl | |
| CHEBI:77421 | |
| C1=CC=C(C=C1)OC2=CC=C(C=C2)Br |
| C12H9BrO | |
| JDUYPUMQALQRCN-UHFFFAOYSA-N | |
| 7565 | |
| 1-bromo-4-phenoxybenzene |
Safety and Handling
GHS H Statement
Harmful if swallowed.
May cause an allergic skin reaction.
Causes serious eye damage.
Toxic to aquatic life with long lasting effects.
GHS P Statement
Wear protective gloves/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
Avoid release to the environment
GHS Signal Word: Danger
EINECSNumber : 202-952-4
RUO â Research Use Only