Learn More
4-(Boc-aminomethyl)benzoic acid, 97%
CAS: 33233-67-9 | C13H16NO4 | 250.28 g/mol
Supplier: Thermo Scientific Chemicals H6639006
| Quantity | 5 g |
|---|
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 33233-67-9 | |
| 250.28 | |
| LNKHBRDWRIIROP-UHFFFAOYSA-M | |
| 853605 | |
| CC(C)(C)OC(=O)NCC1=CC=C(C=C1)C([O-])=O |
| C13H16NO4 | |
| MFCD00228182 | |
| 4-tert-butoxycarbonylamino methyl benzoic acid, 4-tert-butoxycarbonyl amino methyl benzoic acid, 4-tert-butoxy carbonyl amino methyl benzoic acid, boc-4-aminomethyl-benzoic acid, 4-boc-aminomethyl-benzoic acid, 4-tert-butoxycarbonylaminomethyl benzoic acid, 4-n-tert-butyloxycarbonyl amino methyl benzoic acid, benzoic acid, 4-1,1-dimethylethoxy carbonyl amino methyl | |
| 4-({[(tert-butoxy)carbonyl]amino}methyl)benzoate |
Specifications
| 164°C to 168°C | |
| 33233-67-9 | |
| C13H16NO4 | |
| 2854286 | |
| LNKHBRDWRIIROP-UHFFFAOYSA-M | |
| 4-({[(tert-butoxy)carbonyl]amino}methyl)benzoate | |
| 250.28 | |
| 251.28 | |
| Crystalline |
| 4-(Boc-aminomethyl)benzoic acid | |
| White | |
| MFCD00228182 | |
| 4-tert-butoxycarbonylamino methyl benzoic acid, 4-tert-butoxycarbonyl amino methyl benzoic acid, 4-tert-butoxy carbonyl amino methyl benzoic acid, boc-4-aminomethyl-benzoic acid, 4-boc-aminomethyl-benzoic acid, 4-tert-butoxycarbonylaminomethyl benzoic acid, 4-n-tert-butyloxycarbonyl amino methyl benzoic acid, benzoic acid, 4-1,1-dimethylethoxy carbonyl amino methyl | |
| CC(C)(C)OC(=O)NCC1=CC=C(C=C1)C([O-])=O | |
| 5 g | |
| 853605 | |
| 98% |
Safety and Handling
P261-P264b-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P312-P330-P332+P313-P362-P501c
H302-H315-H319-H335
TSCA : No
Recommended Storage : Ambient temperatures