missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Benzylphenol 98.0+%, TCI America™
$159.97 - $1,629.38
Chemical Identifiers
| CAS | 101-53-1 |
|---|---|
| Molecular Formula | C13H12O |
| Molecular Weight (g/mol) | 184.238 |
| MDL Number | MFCD00002384 |
| InChI Key | HJSPWKGEPDZNLK-UHFFFAOYSA-N |
| Synonym | p-benzylphenol, fesiasept, 4-hydroxydiphenylmethane, 4-hydroxyditane, 4-phenylmethyl phenol, phenol, 4-phenylmethyl, p-hydroxydiphenyl methane, alpha-phenyl-p-cresol, p-hydroxydiphenylmethane, 4-benzyl-phenol |
| PubChem CID | 7563 |
| IUPAC Name | 4-benzylphenol |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)O |
Chemical Identifiers
| 101-53-1 | |
| 184.238 | |
| HJSPWKGEPDZNLK-UHFFFAOYSA-N | |
| 7563 | |
| C1=CC=C(C=C1)CC2=CC=C(C=C2)O |
| C13H12O | |
| MFCD00002384 | |
| p-benzylphenol, fesiasept, 4-hydroxydiphenylmethane, 4-hydroxyditane, 4-phenylmethyl phenol, phenol, 4-phenylmethyl, p-hydroxydiphenyl methane, alpha-phenyl-p-cresol, p-hydroxydiphenylmethane, 4-benzyl-phenol | |
| 4-benzylphenol |
Specifications
| 101-53-1 | |
| White-Yellow | |
| C13H12O | |
| 25 g | |
| HJSPWKGEPDZNLK-UHFFFAOYSA-N | |
| 4-benzylphenol | |
| 7563 | |
| ≥98.0% (GC) | |
| 4-Benzylphenol |
| 83°C | |
| 330°C | |
| MFCD00002384 | |
| p-benzylphenol, fesiasept, 4-hydroxydiphenylmethane, 4-hydroxyditane, 4-phenylmethyl phenol, phenol, 4-phenylmethyl, p-hydroxydiphenyl methane, alpha-phenyl-p-cresol, p-hydroxydiphenylmethane, 4-benzyl-phenol | |
| C1=CC=C(C=C1)CC2=CC=C(C=C2)O | |
| 184.238 | |
| 184.24 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : (3)-0547
RTECSNumber : SM8330500
TSCA : Yes