Learn More
4-Aminoantipyrine, 98%
4-Aminoantipyrine, 98%, C11H13N3O, CAS Number-83-07-8, 4-aminoantipyrene, aminoantipyrin, ampyrone, 4-aminoantipyrine, 4-aminophenazone, metapirazone, solnapyrin-a, aminoazophene, solvapyrin-a, aminoantipyrine, 25g, (5% aq. soln.) clear, 24,273, 100.0, 97.5, CHEBI:59026, Brown-Yellow to Yellow | CAS: 83-07-8 | C11H13N3O | 203.25 g/mol
Supplier: Thermo Scientific Chemicals 103151000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 4-Aminoantipyrine | |
| 83-07-8 | |
| 100.0 | |
| Brown-Yellow to Yellow | |
| 1.5% max. | |
| 98% | |
| C11H13N3O | |
| 100 g | |
| 0.8 | |
| 4-aminoantipyrine, ampyrone, metapirazone, aminoantipyrine, solvapyrin-a, aminoazophene, 4-aminophenazone, 4-aminoantipyrene, aminoantipyrin, solnapyrin-a | |
| RLFWWDJHLFCNIJ-UHFFFAOYSA-N | |
| 4-amino-1,5-dimethyl-2-phenylpyrazol-3-one | |
| 2151 | |
| 203.25 | |
| Crystals or Powder |
| 98% | |
| 97.5 | |
| 105.5°C to 110.0°C | |
| 0.8000g/mL | |
| Authentic | |
| Glass bottle | |
| MFCD00003145 | |
| 24,273 | |
| 15,413 | |
| (5% in water) Clear | |
| CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N | |
| 203.25 | |
| CHEBI:59026 | |
| 98% |
Chemical Identifiers
| 83-07-8 | |
| 203.25 | |
| RLFWWDJHLFCNIJ-UHFFFAOYSA-N | |
| 2151 | |
| 4-amino-1,5-dimethyl-2-phenylpyrazol-3-one |
| C11H13N3O | |
| MFCD00003145 | |
| 4-aminoantipyrine, ampyrone, metapirazone, aminoantipyrine, solvapyrin-a, aminoazophene, 4-aminophenazone, 4-aminoantipyrene, aminoantipyrin, solnapyrin-a | |
| CHEBI:59026 | |
| CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
May cause respiratory irritation.
Causes serious eye irritation.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
If eye irritation persists: Get medical advice/attent
GHS Signal Word: Warning
EINECSNumber : 201-452-3
RTECSNumber : CD2480000
TSCA : TSCA
RUO – Research Use Only