Learn More
4-Aminoantipyrine, 98%
4-Aminoantipyrine, 98%, C11H13N3O, CAS Number-83-07-8, 4-aminoantipyrene, aminoantipyrin, ampyrone, 4-aminoantipyrine, 4-aminophenazone, metapirazone, solnapyrin-a, aminoazophene, solvapyrin-a, aminoantipyrine, 25g, (5% aq. soln.) clear, 24,273, 100.0, 97.5, CHEBI:59026, Brown-Yellow to Yellow | CAS: 83-07-8 | C11H13N3O | 203.25 g/mol
$102.24 - $177.05
Chemical Identifiers
| CAS | 83-07-8 |
|---|---|
| Molecular Formula | C11H13N3O |
| Molecular Weight (g/mol) | 203.25 |
| MDL Number | MFCD00003145 |
| InChI Key | RLFWWDJHLFCNIJ-UHFFFAOYSA-N |
| Synonym | 4-aminoantipyrine, ampyrone, metapirazone, aminoantipyrine, solvapyrin-a, aminoazophene, 4-aminophenazone, 4-aminoantipyrene, aminoantipyrin, solnapyrin-a |
| PubChem CID | 2151 |
| ChEBI | CHEBI:59026 |
| IUPAC Name | 4-amino-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC103150250
|
Thermo Scientific Chemicals
103150250 |
25 g | Glass bottle |
Each for $102.24
|
|
||||
|
AC103151000
|
Thermo Scientific Chemicals
103151000 |
100 g | Glass bottle |
Each for $177.05
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 83-07-8 | |
| 203.25 | |
| RLFWWDJHLFCNIJ-UHFFFAOYSA-N | |
| 2151 | |
| 4-amino-1,5-dimethyl-2-phenylpyrazol-3-one |
| C11H13N3O | |
| MFCD00003145 | |
| 4-aminoantipyrine, ampyrone, metapirazone, aminoantipyrine, solvapyrin-a, aminoazophene, 4-aminophenazone, 4-aminoantipyrene, aminoantipyrin, solnapyrin-a | |
| CHEBI:59026 | |
| CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N |
Specifications
| 83-07-8 | |
| 100.0 | |
| Brown-Yellow to Yellow | |
| 1.5% max. | |
| 98% | |
| C11H13N3O | |
| 25 g | |
| 0.8 | |
| 4-aminoantipyrine, ampyrone, metapirazone, aminoantipyrine, solvapyrin-a, aminoazophene, 4-aminophenazone, 4-aminoantipyrene, aminoantipyrin, solnapyrin-a | |
| RLFWWDJHLFCNIJ-UHFFFAOYSA-N | |
| 4-amino-1,5-dimethyl-2-phenylpyrazol-3-one | |
| 2151 | |
| 203.25 | |
| Crystals or Powder |
| 97.5 | |
| 105.5°C to 110.0°C | |
| 0.8000g/mL | |
| Authentic | |
| Glass bottle | |
| MFCD00003145 | |
| 24,273 | |
| 15,413 | |
| (5% in water) Clear | |
| CC1=C(C(=O)N(N1C)C2=CC=CC=C2)N | |
| 203.25 | |
| CHEBI:59026 | |
| 98% | |
| 4-Aminoantipyrine, 98% |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes skin irritation.
May cause respiratory irritation.
Causes serious eye irritation.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
If eye irritation persists: Get medical advice/attent
GHS Signal Word: Warning
EINECSNumber : 201-452-3
RTECSNumber : CD2480000
TSCA : TSCA
RUO – Research Use Only