Learn More
4,5-Dihydroxynaphthalene-2,7-disulfonic Acid, Disodium Salt Dihydrate, 98%
4,5-Dihydroxynaphthalene-2,7-disulfonic acid, disodium salt dihydrate, 98%, C10H6Na2O8S2.2H2O, CAS Number-5808-22-0 | CAS: 5808-22-0 | C10H6O8S2 | 318.27 g/mol
Supplier: Thermo Scientific Chemicals 155190250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 4,5-Dihydroxynaphthalene-2,7-disulfonic acid, disodium salt dihydrate | |
| 97.5 | |
| >300.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00150612 | |
| 11, 307 | |
| chromotropic acid sodium salt, 4,5-dihydroxy-2,7-naphthalenedisulfonate, di sodium; 4,5-dihydroxy-7-sulfo-naphthalene-2-sulfonic acid, 4,5-dihydroxynaphthalene-2,7-disulfonic acid disodium salt dihydrate, acs 5g | |
| QUEAKWJKJBFNEG-UHFFFAOYSA-L | |
| 2,7-disodium 4,5-dihydroxynaphthalene-2,7-disulfonate dihydrate | |
| 124202444 | |
| 98% | |
| Powder |
| 5808-22-0 | |
| 100.0 | |
| Beige-Gray to White or Brown | |
| 98% | |
| C10H10Na2O10S2 | |
| 25 g | |
| 15, 2245 | |
| Solubility in water: very soluble | |
| O.O.OC1=CC(=CC2=CC(=CC(O)=C12)S(=O)(=O)O[Na])S(=O)(=O)O[Na] | |
| 400.28 | |
| 400.28 | |
| 0.02% max. (in water) |
Chemical Identifiers
| 5808-22-0 | |
| 400.28 | |
| QUEAKWJKJBFNEG-UHFFFAOYSA-L | |
| 124202444 | |
| O.O.OC1=CC(=CC2=CC(=CC(O)=C12)S(=O)(=O)O[Na])S(=O)(=O)O[Na] |
| C10H10Na2O10S2 | |
| MFCD00150612 | |
| chromotropic acid sodium salt, 4,5-dihydroxy-2,7-naphthalenedisulfonate, di sodium; 4,5-dihydroxy-7-sulfo-naphthalene-2-sulfonic acid, 4,5-dihydroxynaphthalene-2,7-disulfonic acid disodium salt dihydrate, acs 5g | |
| 2,7-disodium 4,5-dihydroxynaphthalene-2,7-disulfonate dihydrate |
Safety and Handling
GHS H Statement
May cause respiratory irritation.
Causes skin irritation.
Causes serious eye irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
If skin irritation occurs: Get medical advice/attention.
If eye irritation persists: Get medical advice/attention.
Avoid breathing dust/fume/
GHS Signal Word: Warning
RUO – Research Use Only