Learn More
4,4'-Thiodiphenol, 98+%
CAS: 2664-63-3 | C12H10O2S | 218.27 g/mol
$112.45 - $478.40
Chemical Identifiers
| CAS | 2664-63-3 |
|---|---|
| Molecular Formula | C12H10O2S |
| Molecular Weight (g/mol) | 218.27 |
| MDL Number | MFCD00002349 |
| InChI Key | VWGKEVWFBOUAND-UHFFFAOYSA-N |
| Synonym | 4,4'-thiodiphenol, bis 4-hydroxyphenyl sulfide, thiobisphenol, 4,4'-thiobis-phenol, phenol, 4,4'-thiobis, 4,4'-thiobisphenol, 4,4'-dihydroxydiphenyl sulfide, bis 4-oxyphenyl sulfide, p,p'-dihydroxydiphenyl sulfide, 4,4'-dioxydiphenyl sulfide |
| PubChem CID | 17570 |
| ChEBI | CHEBI:38957 |
| IUPAC Name | 4-(4-hydroxyphenyl)sulfanylphenol |
| SMILES | OC1=CC=C(SC2=CC=C(O)C=C2)C=C1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAL0430822
|
Thermo Scientific Chemicals
L0430822 |
100 g |
Each for $112.45
|
|
|||||
|
AAL0430836
|
Thermo Scientific Chemicals
L0430836 |
500 g |
Each for $478.40
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 2664-63-3 | |
| 218.27 | |
| VWGKEVWFBOUAND-UHFFFAOYSA-N | |
| 17570 | |
| 4-(4-hydroxyphenyl)sulfanylphenol |
| C12H10O2S | |
| MFCD00002349 | |
| 4,4'-thiodiphenol, bis 4-hydroxyphenyl sulfide, thiobisphenol, 4,4'-thiobis-phenol, phenol, 4,4'-thiobis, 4,4'-thiobisphenol, 4,4'-dihydroxydiphenyl sulfide, bis 4-oxyphenyl sulfide, p,p'-dihydroxydiphenyl sulfide, 4,4'-dioxydiphenyl sulfide | |
| CHEBI:38957 | |
| OC1=CC=C(SC2=CC=C(O)C=C2)C=C1 |
Specifications
| 2664-63-3 | |
| C12H10O2S | |
| 100 g | |
| 2050739 | |
| 4,4'-thiodiphenol, bis 4-hydroxyphenyl sulfide, thiobisphenol, 4,4'-thiobis-phenol, phenol, 4,4'-thiobis, 4,4'-thiobisphenol, 4,4'-dihydroxydiphenyl sulfide, bis 4-oxyphenyl sulfide, p,p'-dihydroxydiphenyl sulfide, 4,4'-dioxydiphenyl sulfide | |
| OC1=CC=C(SC2=CC=C(O)C=C2)C=C1 | |
| 218.27 | |
| CHEBI:38957 | |
| ≥98% |
| 151°C to 155°C | |
| MFCD00002349 | |
| UN3261 | |
| Air Sensitive | |
| VWGKEVWFBOUAND-UHFFFAOYSA-N | |
| 4-(4-hydroxyphenyl)sulfanylphenol | |
| 17570 | |
| 218.27 | |
| 4,4'-Thiodiphenol |
Safety and Handling
GHS H Statement
H314-H318
Causes severe skin burns and eye damage.
Causes serious eye damage.
P260-P264b-P271-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P501c
H314-H335
DOTInformation : Transport Hazard Class: 8; Packing Group: II; Proper Shipping Name: CORROSIVE SOLID, ACIDIC, ORGANIC, N.O.S.
EINECSNumber : 220-197-9
RTECSNumber : SN0800000
TSCA : Yes
Recommended Storage : Ambient temperatures; Store under Argon
RUO – Research Use Only