missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4,4'-Methylenebis(2,6-di-tert-butylphenol) 98.0+%, TCI America™
$48.11 - $217.33
Chemical Identifiers
| CAS | 118-82-1 |
|---|---|
| Molecular Formula | C29H44O2 |
| Molecular Weight (g/mol) | 424.669 |
| MDL Number | MFCD00008822 |
| InChI Key | MDWVSAYEQPLWMX-UHFFFAOYSA-N |
| Synonym | 4,4'-methylenebis 2,6-di-tert-butylphenol, bimox m, ionox 220, binox m, antioxidant e 702, mb 1 antioxidant, ethyl 702, ionox 220 antioxidant, etil 702, 4,4'-methylenebis 2,6-di-t-butylphenol |
| PubChem CID | 8372 |
| ChEBI | CHEBI:34369 |
| IUPAC Name | 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenol |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C |
Chemical Identifiers
| 118-82-1 | |
| 424.669 | |
| MDWVSAYEQPLWMX-UHFFFAOYSA-N | |
| 8372 | |
| 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenol |
| C29H44O2 | |
| MFCD00008822 | |
| 4,4'-methylenebis 2,6-di-tert-butylphenol, bimox m, ionox 220, binox m, antioxidant e 702, mb 1 antioxidant, ethyl 702, ionox 220 antioxidant, etil 702, 4,4'-methylenebis 2,6-di-t-butylphenol | |
| CHEBI:34369 | |
| CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C |
Specifications
| 118-82-1 | |
| White-Yellow | |
| MFCD00008822 | |
| 4,4'-methylenebis 2,6-di-tert-butylphenol, bimox m, ionox 220, binox m, antioxidant e 702, mb 1 antioxidant, ethyl 702, ionox 220 antioxidant, etil 702, 4,4'-methylenebis 2,6-di-t-butylphenol | |
| CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C | |
| 424.669 | |
| CHEBI:34369 | |
| ≥98.0% (GC) | |
| 4,4′-Methylenebis(2,6-di-tert-butylphenol) |
| 155°C | |
| C29H44O2 | |
| 25 g | |
| MDWVSAYEQPLWMX-UHFFFAOYSA-N | |
| 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]phenol | |
| 8372 | |
| 424.67 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : (4)-0039
RTECSNumber : SL9650000
TSCA : Yes