missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals 4-(4-Dimethylaminophenylazo)benzoic acid sodium salt, 97%
CAS: 845-46-5 | C15H14N3NaO2 | 291.27 g/mol
Supplier: Thermo Scientific Chemicals 408110025
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 4-(4-Dimethylaminophenylazo)benzoic acid sodium salt | |
| 845-46-5 | |
| 100.0 | |
| Authentic | |
| Glass bottle | |
| MFCD00020350 | |
| p-p-dimethylaminophenylazo benzoic acid sodium salt, 4-4-dimethylaminophenylazo benzoic acid sodium salt, benzoic acid, 4-4-dimethylamino phenyl azo-, sodium salt, benzoic acid, p-p-dimethylamino phenyl azo-, sodium salt, benzoic acid, 4-2-4-dimethylamino phenyl diazenyl-, sodium salt 1:1, sodium 4-4-dimethylaminophenylazo benzoate, 4-e-4-dimethylaminophenyl azo benzoic acid | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)[O-].[Na+] | |
| 291.27 | |
| 291.27 | |
| Extra Pure |
| 98% | |
| 97.5 | |
| Orange | |
| 97.5% min | |
| C15H14N3NaO2 | |
| 2.5 g | |
| OSCKRHPYZNTEIO-UHFFFAOYSA-M | |
| sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzoate | |
| 23674498 | |
| 98% | |
| Crystalline Powder |
Chemical Identifiers
| 845-46-5 | |
| 291.27 | |
| OSCKRHPYZNTEIO-UHFFFAOYSA-M | |
| 23674498 | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)[O-].[Na+] |
| C15H14N3NaO2 | |
| MFCD00020350 | |
| p-p-dimethylaminophenylazo benzoic acid sodium salt, 4-4-dimethylaminophenylazo benzoic acid sodium salt, benzoic acid, 4-4-dimethylamino phenyl azo-, sodium salt, benzoic acid, p-p-dimethylamino phenyl azo-, sodium salt, benzoic acid, 4-2-4-dimethylamino phenyl diazenyl-, sodium salt 1:1, sodium 4-4-dimethylaminophenylazo benzoate, 4-e-4-dimethylaminophenyl azo benzoic acid | |
| sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzoate |
Safety and Handling
TSCA : TSCA
RUO – Research Use Only