missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals 4-(4-Dimethylaminophenylazo)benzoic acid sodium salt, 97%
CAS: 845-46-5 | C15H14N3NaO2 | 291.27 g/mol
$142.91 - $405.74
Chemical Identifiers
| CAS | 845-46-5 |
|---|---|
| Molecular Formula | C15H14N3NaO2 |
| Molecular Weight (g/mol) | 291.27 |
| MDL Number | MFCD00020350 |
| InChI Key | OSCKRHPYZNTEIO-UHFFFAOYSA-M |
| Synonym | p-p-dimethylaminophenylazo benzoic acid sodium salt, 4-4-dimethylaminophenylazo benzoic acid sodium salt, benzoic acid, 4-4-dimethylamino phenyl azo-, sodium salt, benzoic acid, p-p-dimethylamino phenyl azo-, sodium salt, benzoic acid, 4-2-4-dimethylamino phenyl diazenyl-, sodium salt 1:1, sodium 4-4-dimethylaminophenylazo benzoate, 4-e-4-dimethylaminophenyl azo benzoic acid |
| PubChem CID | 23674498 |
| IUPAC Name | sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzoate |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)[O-].[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC408110025
|
Thermo Scientific Chemicals
408110025 |
2.5 g | Glass bottle |
N/A
|
|
||||
|
AC408110100
|
Thermo Scientific Chemicals
408110100 |
10 g | Glass bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 845-46-5 | |
| 291.27 | |
| OSCKRHPYZNTEIO-UHFFFAOYSA-M | |
| 23674498 | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)[O-].[Na+] |
| C15H14N3NaO2 | |
| MFCD00020350 | |
| p-p-dimethylaminophenylazo benzoic acid sodium salt, 4-4-dimethylaminophenylazo benzoic acid sodium salt, benzoic acid, 4-4-dimethylamino phenyl azo-, sodium salt, benzoic acid, p-p-dimethylamino phenyl azo-, sodium salt, benzoic acid, 4-2-4-dimethylamino phenyl diazenyl-, sodium salt 1:1, sodium 4-4-dimethylaminophenylazo benzoate, 4-e-4-dimethylaminophenyl azo benzoic acid | |
| sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzoate |
Specifications
| 845-46-5 | |
| 100.0 | |
| Authentic | |
| Glass bottle | |
| MFCD00020350 | |
| p-p-dimethylaminophenylazo benzoic acid sodium salt, 4-4-dimethylaminophenylazo benzoic acid sodium salt, benzoic acid, 4-4-dimethylamino phenyl azo-, sodium salt, benzoic acid, p-p-dimethylamino phenyl azo-, sodium salt, benzoic acid, 4-2-4-dimethylamino phenyl diazenyl-, sodium salt 1:1, sodium 4-4-dimethylaminophenylazo benzoate, 4-e-4-dimethylaminophenyl azo benzoic acid | |
| CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)[O-].[Na+] | |
| 291.27 | |
| 291.27 | |
| Extra Pure | |
| 4-(4-Dimethylaminophenylazo)benzoic acid sodium salt, 98% |
| 97.5 | |
| Orange | |
| 97.5% min | |
| C15H14N3NaO2 | |
| 2.5 g | |
| OSCKRHPYZNTEIO-UHFFFAOYSA-M | |
| sodium;4-[[4-(dimethylamino)phenyl]diazenyl]benzoate | |
| 23674498 | |
| 98% | |
| Crystalline Powder |
Safety and Handling
TSCA : TSCA
RUO – Research Use Only