missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4,4'-Dimethoxybenzil, 99+%
CAS: 1226-42-2 | C16H14O4 | 270.27 g/mol
Supplier: Thermo Scientific Chemicals 170450050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 4, 4'-Dimethoxybenzil | |
| 1226-42-2 | |
| 100.0 | |
| Yellow | |
| 99+% | |
| C16H14O4 | |
| MFCD00008405 | |
| 08, 428 | |
| YNANGXWUZWWFKX-UHFFFAOYSA-N | |
| 1,2-bis(4-methoxyphenyl)ethane-1,2-dione | |
| 71043 | |
| 99+% |
| 99+% | |
| 99.0 | |
| 131.0°C to 134.0°C | |
| Authentic | |
| Glass bottle | |
| CH3OC6H4COCOC6H4OCH3 | |
| 5 g | |
| 4,4'-dimethoxybenzil, anisil, p-anisil, 1,2-bis 4-methoxyphenyl ethane-1,2-dione, bis 4-methoxyphenyl ethanedione, ethanedione, bis 4-methoxyphenyl, di-p-anisoyl, p,p'-dimethoxybenzil, 1,2-ethanedione, 1,2-bis 4-methoxyphenyl, 1,2-bis 4-methoxyphenyl-1,2-ethanedione | |
| COC1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)OC | |
| 270.27 | |
| 270.27 | |
| Fine Crystalline Powder |
Chemical Identifiers
| 1226-42-2 | |
| 270.27 | |
| YNANGXWUZWWFKX-UHFFFAOYSA-N | |
| 71043 | |
| COC1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)OC |
| C16H14O4 | |
| MFCD00008405 | |
| 4,4'-dimethoxybenzil, anisil, p-anisil, 1,2-bis 4-methoxyphenyl ethane-1,2-dione, bis 4-methoxyphenyl ethanedione, ethanedione, bis 4-methoxyphenyl, di-p-anisoyl, p,p'-dimethoxybenzil, 1,2-ethanedione, 1,2-bis 4-methoxyphenyl, 1,2-bis 4-methoxyphenyl-1,2-ethanedione | |
| 1,2-bis(4-methoxyphenyl)ethane-1,2-dione |
Safety and Handling
EINECSNumber : 214-960-5
TSCA : TSCA
RUO – Research Use Only