missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4,4'-Di-tert-butylbiphenyl, 99+%
CAS: 1625-91-8 | C20H26 | 266.42 g/mol
$412.59 - $412.59
Chemical Identifiers
| CAS | 1625-91-8 |
|---|---|
| Molecular Formula | C20H26 |
| Molecular Weight (g/mol) | 266.42 |
| MDL Number | MFCD00008834 |
| InChI Key | CDKCEZNPAYWORX-UHFFFAOYSA-N |
| Synonym | 4,4'-di-tert-butylbiphenyl, 4,4'-di-tert-butyl-1,1'-biphenyl, 4,4'-di-t-butylbiphenyl, 1-tert-butyl-4-4-tert-butylphenyl benzene, 1,1'-biphenyl, 4,4'-bis 1,1-dimethylethyl, 1-tert-butyl-4-4-tert-butyl phenyl benzene, di-t-butylbiphenyl, pubchem9048, acmc-209st2, 4,4'-di-tertbutylbiphenyl |
| PubChem CID | 74195 |
| IUPAC Name | 1-tert-butyl-4-(4-tert-butylphenyl)benzene |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC=C(C=C2)C(C)(C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC291880250
|
Thermo Scientific Chemicals
291880250 |
25 g | Glass bottle |
N/A
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Reduction reagentChemical Identifiers
| 1625-91-8 | |
| 266.42 | |
| CDKCEZNPAYWORX-UHFFFAOYSA-N | |
| 74195 | |
| CC(C)(C)C1=CC=C(C=C1)C2=CC=C(C=C2)C(C)(C)C |
| C20H26 | |
| MFCD00008834 | |
| 4,4'-di-tert-butylbiphenyl, 4,4'-di-tert-butyl-1,1'-biphenyl, 4,4'-di-t-butylbiphenyl, 1-tert-butyl-4-4-tert-butylphenyl benzene, 1,1'-biphenyl, 4,4'-bis 1,1-dimethylethyl, 1-tert-butyl-4-4-tert-butyl phenyl benzene, di-t-butylbiphenyl, pubchem9048, acmc-209st2, 4,4'-di-tertbutylbiphenyl | |
| 1-tert-butyl-4-(4-tert-butylphenyl)benzene |
Specifications
| 1625-91-8 | |
| 100.0 | |
| Orange-Yellow to Yellow | |
| Authentic | |
| Glass bottle | |
| (CH3)3CC6H4C6H4C(CH3)3 | |
| 25 g | |
| 4,4'-di-tert-butylbiphenyl, 4,4'-di-tert-butyl-1,1'-biphenyl, 4,4'-di-t-butylbiphenyl, 1-tert-butyl-4-4-tert-butylphenyl benzene, 1,1'-biphenyl, 4,4'-bis 1,1-dimethylethyl, 1-tert-butyl-4-4-tert-butyl phenyl benzene, di-t-butylbiphenyl, pubchem9048, acmc-209st2, 4,4'-di-tertbutylbiphenyl | |
| CDKCEZNPAYWORX-UHFFFAOYSA-N | |
| 1-tert-butyl-4-(4-tert-butylphenyl)benzene | |
| 74195 | |
| 99+% | |
| 4, 4'-Di-tert-butylbiphenyl |
| 99.0 | |
| 126°C to 129°C | |
| 190°C to 192°C (13.0 mmHg) | |
| 99% min. (GC) | |
| C20H26 | |
| MFCD00008834 | |
| 05, 298 | |
| Solubility in water: .. Other solubilities: soluble in dioxane | |
| CC(C)(C)C1=CC=C(C=C1)C2=CC=C(C=C2)C(C)(C)C | |
| 266.42 | |
| 266.42 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : 216-615-4
RUO – Research Use Only