missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4,4'-Di-tert-butylbiphenyl, 99+%
CAS: 1625-91-8 | C20H26 | 266.42 g/mol
Supplier: Thermo Scientific Chemicals 291880250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Reduction reagentSpecifications
| 4, 4'-Di-tert-butylbiphenyl | |
| 99.0 | |
| 126°C to 129°C | |
| 190°C to 192°C (13.0 mmHg) | |
| 99% min. (GC) | |
| C20H26 | |
| MFCD00008834 | |
| 05, 298 | |
| Solubility in water: .. Other solubilities: soluble in dioxane | |
| CC(C)(C)C1=CC=C(C=C1)C2=CC=C(C=C2)C(C)(C)C | |
| 266.42 | |
| 266.42 | |
| Crystalline Powder |
| 1625-91-8 | |
| 100.0 | |
| Orange-Yellow to Yellow | |
| Authentic | |
| Glass bottle | |
| (CH3)3CC6H4C6H4C(CH3)3 | |
| 25 g | |
| 4,4'-di-tert-butylbiphenyl, 4,4'-di-tert-butyl-1,1'-biphenyl, 4,4'-di-t-butylbiphenyl, 1-tert-butyl-4-4-tert-butylphenyl benzene, 1,1'-biphenyl, 4,4'-bis 1,1-dimethylethyl, 1-tert-butyl-4-4-tert-butyl phenyl benzene, di-t-butylbiphenyl, pubchem9048, acmc-209st2, 4,4'-di-tertbutylbiphenyl | |
| CDKCEZNPAYWORX-UHFFFAOYSA-N | |
| 1-tert-butyl-4-(4-tert-butylphenyl)benzene | |
| 74195 | |
| 99+% |
Chemical Identifiers
| 1625-91-8 | |
| 266.42 | |
| CDKCEZNPAYWORX-UHFFFAOYSA-N | |
| 74195 | |
| CC(C)(C)C1=CC=C(C=C1)C2=CC=C(C=C2)C(C)(C)C |
| C20H26 | |
| MFCD00008834 | |
| 4,4'-di-tert-butylbiphenyl, 4,4'-di-tert-butyl-1,1'-biphenyl, 4,4'-di-t-butylbiphenyl, 1-tert-butyl-4-4-tert-butylphenyl benzene, 1,1'-biphenyl, 4,4'-bis 1,1-dimethylethyl, 1-tert-butyl-4-4-tert-butyl phenyl benzene, di-t-butylbiphenyl, pubchem9048, acmc-209st2, 4,4'-di-tertbutylbiphenyl | |
| 1-tert-butyl-4-(4-tert-butylphenyl)benzene |
Safety and Handling
EINECSNumber : 216-615-4
RUO – Research Use Only