missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3-(Trimethoxysilyl)propyl Methacrylate (stabilized with BHT) 98.0+%, TCI America™
Supplier: TCI America M0725100ML
Specifications
| 3-(Trimethoxysilyl)propyl Methacrylate (stabilized with BHT) | |
| Colorless | |
| C10H20O5Si | |
| 100 mL | |
| XDLMVUHYZWKMMD-UHFFFAOYSA-N | |
| 3-trimethoxysilylpropyl 2-methylprop-2-enoate | |
| 17318 | |
| ≥98.0% (GC) |
| 2530-85-0 | |
| 110°C | |
| MFCD00008593 | |
| 3-trimethoxysilyl propyl methacrylate, 3-methacryloxypropyltrimethoxysilane, methacryloxypropyltrimethoxysilane, dynasylan memo, silicone a-174, union carbide a-174, mops-m, silane a-174, nuca 174, 2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester | |
| CC(=C)C(=O)OCCC[Si](OC)(OC)OC | |
| 248.35 | |
| 248.35 | |
| Liquid |
Chemical Identifiers
| 2530-85-0 | |
| 248.35 | |
| XDLMVUHYZWKMMD-UHFFFAOYSA-N | |
| 17318 | |
| CC(=C)C(=O)OCCC[Si](OC)(OC)OC |
| C10H20O5Si | |
| MFCD00008593 | |
| 3-trimethoxysilyl propyl methacrylate, 3-methacryloxypropyltrimethoxysilane, methacryloxypropyltrimethoxysilane, dynasylan memo, silicone a-174, union carbide a-174, mops-m, silane a-174, nuca 174, 2-propenoic acid, 2-methyl-, 3-trimethoxysilyl propyl ester | |
| 3-trimethoxysilylpropyl 2-methylprop-2-enoate |
Safety and Handling
EINECSNumber : (2)-2076
RTECSNumber : UC0230000
TSCA : Yes