Learn More
3-Nitrobenzoyl chloride, 98%
CAS: 121-90-4 | C7H4ClNO3 | 185.563 g/mol
$80.15 - $956.79
Chemical Identifiers
| CAS | 121-90-4 |
|---|---|
| Molecular Formula | C7H4ClNO3 |
| Molecular Weight (g/mol) | 185.563 |
| MDL Number | MFCD00007247 |
| InChI Key | NXTNASSYJUXJDV-UHFFFAOYSA-N |
| Synonym | m-nitrobenzoyl chloride, benzoyl chloride, 3-nitro, benzoyl chloride, m-nitro, 3-nitro-benzoyl chloride, ccris 1186, m-nitrobenzoylchloride, chlorid kyseliny m-nitrobenzoove, 3-nitrobenzoylchloride, chlorid kyseliny m-nitrobenzoove czech, m-nitrobenzoylchlorid |
| PubChem CID | 8495 |
| IUPAC Name | 3-nitrobenzoyl chloride |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)Cl |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1057918
|
Thermo Scientific Chemicals
A1057918 |
50 g |
Each for $80.15
|
|
|||||
|
AAA1057930
|
Thermo Scientific Chemicals
A1057930 |
250 g |
Each for $291.27
|
|
|||||
|
AAA105790B
|
Thermo Scientific Chemicals
A105790B |
1000 g |
Each for $956.79
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 121-90-4 | |
| 185.563 | |
| NXTNASSYJUXJDV-UHFFFAOYSA-N | |
| 8495 | |
| C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)Cl |
| C7H4ClNO3 | |
| MFCD00007247 | |
| m-nitrobenzoyl chloride, benzoyl chloride, 3-nitro, benzoyl chloride, m-nitro, 3-nitro-benzoyl chloride, ccris 1186, m-nitrobenzoylchloride, chlorid kyseliny m-nitrobenzoove, 3-nitrobenzoylchloride, chlorid kyseliny m-nitrobenzoove czech, m-nitrobenzoylchlorid | |
| 3-nitrobenzoyl chloride |
Specifications
| 121-90-4 | |
| 1.42 | |
| >110°C (230°F) | |
| C7H4ClNO3 | |
| 50 g | |
| 777186 | |
| m-nitrobenzoyl chloride, benzoyl chloride, 3-nitro, benzoyl chloride, m-nitro, 3-nitro-benzoyl chloride, ccris 1186, m-nitrobenzoylchloride, chlorid kyseliny m-nitrobenzoove, 3-nitrobenzoylchloride, chlorid kyseliny m-nitrobenzoove czech, m-nitrobenzoylchlorid | |
| C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)Cl | |
| 185.563 | |
| 185.57 | |
| 3-Nitrobenzoyl chloride |
| 31°C to 35°C | |
| 276°C to 278°C (decomposition) | |
| Pungent | |
| MFCD00007247 | |
| UN3261 | |
| Moisture sensitive | |
| NXTNASSYJUXJDV-UHFFFAOYSA-N | |
| 3-nitrobenzoyl chloride | |
| 8495 | |
| 98% |
Safety and Handling
GHS H Statement
H314-H318-H312
Causes severe skin burns and eye damage.
Causes serious eye damage.
Harmful in contact with skin.
P260-P264b-P271-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P501c
H311-H314-H335
DOTInformation : Transport Hazard Class: 8; Packing Group: II; Proper Shipping Name: CORROSIVE SOLID, ACIDIC, ORGANIC, N.O.S.
EINECSNumber : 204-505-9
RTECSNumber : DM6646000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only