Learn More
3-Nitrobenzenesulfonic acid, sodium salt, 97%
CAS: 127-68-4 | C6H4NNaO5S | 225.15 g/mol
$213.07 - $213.07
Chemical Identifiers
| CAS | 127-68-4 |
|---|---|
| Molecular Formula | C6H4NNaO5S |
| Molecular Weight (g/mol) | 225.15 |
| MDL Number | MFCD00007490 |
| InChI Key | LJRGBERXYNQPJI-UHFFFAOYSA-M |
| Synonym | sodium 3-nitrobenzenesulfonate, 3-nitrobenzenesulfonic acid sodium salt, sodium 3-nitrobenzenesulphonate, sodium m-nitrobenzenesulfonate, nitrol s, tiskan czech, ludigol, ludigol f,60, benzenesulfonic acid, 3-nitro-, sodium salt, unii-1f11sxj4c6 |
| PubChem CID | 31389 |
| IUPAC Name | sodium;3-nitrobenzenesulfonate |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)[O-])[N+](=O)[O-].[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC209120010
|
Thermo Scientific Chemicals
209120010 |
1 kg | Plastic Bottle |
Each for $213.07
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 127-68-4 | |
| 225.15 | |
| LJRGBERXYNQPJI-UHFFFAOYSA-M | |
| 31389 | |
| C1=CC(=CC(=C1)S(=O)(=O)[O-])[N+](=O)[O-].[Na+] |
| C6H4NNaO5S | |
| MFCD00007490 | |
| sodium 3-nitrobenzenesulfonate, 3-nitrobenzenesulfonic acid sodium salt, sodium 3-nitrobenzenesulphonate, sodium m-nitrobenzenesulfonate, nitrol s, tiskan czech, ludigol, ludigol f,60, benzenesulfonic acid, 3-nitro-, sodium salt, unii-1f11sxj4c6 | |
| sodium;3-nitrobenzenesulfonate |
Specifications
| 127-68-4 | |
| 100.0 | |
| Yellow | |
| >100°C | |
| 98.5% min. (HPLC) | |
| C6H4NNaO5S | |
| MFCD00007490 | |
| 11, 68 | |
| Solubility in water: 200g/L water (20°C) | |
| C1=CC(=CC(=C1)S(=O)(=O)[O-])[N+](=O)[O-].[Na+] | |
| 225.15 | |
| 225.15 | |
| Crystalline Powder |
| 98.5 | |
| 350.0°C | |
| 6 to 10 (1% aq. soln.) | |
| Authentic | |
| Plastic Bottle | |
| O2NC6H4SO3Na | |
| 1 kg | |
| sodium 3-nitrobenzenesulfonate, 3-nitrobenzenesulfonic acid sodium salt, sodium 3-nitrobenzenesulphonate, sodium m-nitrobenzenesulfonate, nitrol s, tiskan czech, ludigol, ludigol f,60, benzenesulfonic acid, 3-nitro-, sodium salt, unii-1f11sxj4c6 | |
| LJRGBERXYNQPJI-UHFFFAOYSA-M | |
| sodium;3-nitrobenzenesulfonate | |
| 31389 | |
| 99% | |
| 3-Nitrobenzenesulfonic acid, sodium salt |
Safety and Handling
GHS H Statement
May cause an allergic skin reaction.
Causes serious eye irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
If skin irritation occurs: Get medical advice/attention.
IF IN EYES: Rinse cautiously with wa
GHS Signal Word: Warning
EINECSNumber : 204-857-3
RUO – Research Use Only