Learn More
3-Nitrobenzaldehyde, 99%
CAS: 99-61-6 | C7H5NO3 | 151.12 g/mol
$67.15 - $67.15
Chemical Identifiers
| CAS | 99-61-6 |
|---|---|
| Molecular Formula | C7H5NO3 |
| Molecular Weight (g/mol) | 151.12 |
| MDL Number | MFCD00007249 |
| InChI Key | ZETIVVHRRQLWFW-UHFFFAOYSA-N |
| Synonym | m-nitrobenzaldehyde, benzaldehyde, 3-nitro, 3-formylnitrobenzene, meta-nitrobenzaldehyde, benzaldehyde, m-nitro, 5-nitrobenzaldehyde, unii-g4o92ko71z, 3-nitro-benzaldehyde, ccris 1784, m-nitro-benzaldehyde |
| PubChem CID | 7449 |
| IUPAC Name | 3-nitrobenzaldehyde |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC128411000
|
Thermo Scientific Chemicals
128411000 |
100 g | Plastic bottle |
Each for $67.15
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 99-61-6 | |
| 151.12 | |
| ZETIVVHRRQLWFW-UHFFFAOYSA-N | |
| 7449 | |
| C1=CC(=CC(=C1)[N+](=O)[O-])C=O |
| C7H5NO3 | |
| MFCD00007249 | |
| m-nitrobenzaldehyde, benzaldehyde, 3-nitro, 3-formylnitrobenzene, meta-nitrobenzaldehyde, benzaldehyde, m-nitro, 5-nitrobenzaldehyde, unii-g4o92ko71z, 3-nitro-benzaldehyde, ccris 1784, m-nitro-benzaldehyde | |
| 3-nitrobenzaldehyde |
Specifications
| 99-61-6 | |
| 100.0 | |
| Brown-Yellow to Yellow | |
| Authentic | |
| Plastic bottle | |
| O2NC6H4CHO | |
| 100 g | |
| 14, 6587 | |
| Solubility in water: practically insoluble. Other solubilities: soluble in alcohol, chloroformm and ether | |
| C1=CC(=CC(=C1)[N+](=O)[O-])C=O | |
| 151.12 | |
| 151.12 | |
| Granular Powder |
| 98.5 | |
| 56.0°C to 59.0°C | |
| 285.0°C to 290.0°C | |
| 98.5% min. (GC) | |
| C7H5NO3 | |
| MFCD00007249 | |
| 07, 250 | |
| m-nitrobenzaldehyde, benzaldehyde, 3-nitro, 3-formylnitrobenzene, meta-nitrobenzaldehyde, benzaldehyde, m-nitro, 5-nitrobenzaldehyde, unii-g4o92ko71z, 3-nitro-benzaldehyde, ccris 1784, m-nitro-benzaldehyde | |
| ZETIVVHRRQLWFW-UHFFFAOYSA-N | |
| 3-nitrobenzaldehyde | |
| 7449 | |
| 99% | |
| 3-Nitrobenzaldehyde, 99% |
Safety and Handling
GHS H Statement
Toxic to aquatic life with long lasting effects.
Harmful if swallowed.
Causes serious eye irritation.
May cause respiratory irritation.
Causes skin irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
Avoid release to the environment.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
Wear
GHS Signal Word: Warning
EINECSNumber : 202-772-6
RTECSNumber : CU7250000
TSCA : TSCA
RUO – Research Use Only