Learn More
3-Indolepropionic acid, 99%
CAS: 830-96-6 | C11H11NO2 | 189.21 g/mol
Supplier: Thermo Scientific Chemicals 204990500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 3-Indolepropionic acid | |
| 98.5 | |
| 130°C to 136°C | |
| Authentic | |
| Glass bottle | |
| MFCD00005660 | |
| 22, 69 | |
| Solubility in water: slightly soluble | |
| OC(=O)CCC1=CNC2=CC=CC=C12 | |
| 189.21 | |
| CHEBI:43580 | |
| 99% |
| 830-96-6 | |
| 100.0 | |
| Yellow | |
| 98.5% min. (HPLC) | |
| C11H11NO2 | |
| 50 g | |
| 3-indolepropionic acid, indole-3-propionic acid, 3-1h-indol-3-yl propanoic acid, 1h-indole-3-propanoic acid, indolepropionic acid, indolylpropionic acid, 3-3-indolyl propionic acid, 3-3-indolyl propanoic acid, ipa auxin, 1h-indole-3-propionic acid | |
| GOLXRNDWAUTYKT-UHFFFAOYSA-N | |
| 3-(1H-indol-3-yl)propanoic acid | |
| 3744 | |
| 189.21 | |
| Crystalline Powder |
Chemical Identifiers
| 830-96-6 | |
| 189.21 | |
| GOLXRNDWAUTYKT-UHFFFAOYSA-N | |
| 3744 | |
| 3-(1H-indol-3-yl)propanoic acid |
| C11H11NO2 | |
| MFCD00005660 | |
| 3-indolepropionic acid, indole-3-propionic acid, 3-1h-indol-3-yl propanoic acid, 1h-indole-3-propanoic acid, indolepropionic acid, indolylpropionic acid, 3-3-indolyl propionic acid, 3-3-indolyl propanoic acid, ipa auxin, 1h-indole-3-propionic acid | |
| CHEBI:43580 | |
| OC(=O)CCC1=CNC2=CC=CC=C12 |
Safety and Handling
GHS H Statement
Causes skin irritation.
Harmful if swallowed.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
IF
GHS Signal Word: Warning
EINECSNumber : 212-600-1
RUO – Research Use Only