missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3,5-Dimethylpiperidine (cis- and trans- mixture) 98.0+%, TCI America™
Supplier: TCI America D1411500ML
Specifications
| 3,5-Dimethylpiperidine (cis- and trans- mixture) | |
| Colorless | |
| C7H16N | |
| 500 mL | |
| piperidine, 3,5-dimethyl, 3,5-lupetidine, 3,5-dimethylpiperidin, 3,5-dimethylpiperidine, cis + trans, pubchem7709, 3,5-dimethylpiperdine, 3,5 dimethylpiperidine, 3,5-dimethylpiperadine, acmc-1afvq, hexahydro-3,5-lutidine | |
| C[C@H]1C[NH2+]C[C@@H](C)C1 | |
| 114.21 | |
| 113.20 | |
| Liquid |
| 35794-11-7 | |
| 144°C | |
| MFCD00005996,MFCD09832871 | |
| 1993 | |
| IDWRJRPUIXRFRX-KNVOCYPGSA-O | |
| (3R,5S)-3,5-dimethylpiperidin-1-ium | |
| 118259 | |
| ≥98.0% (GC,T) |
Chemical Identifiers
| 35794-11-7 | |
| 114.21 | |
| IDWRJRPUIXRFRX-KNVOCYPGSA-O | |
| 118259 | |
| C[C@H]1C[NH2+]C[C@@H](C)C1 |
| C7H16N | |
| MFCD00005996,MFCD09832871 | |
| piperidine, 3,5-dimethyl, 3,5-lupetidine, 3,5-dimethylpiperidin, 3,5-dimethylpiperidine, cis + trans, pubchem7709, 3,5-dimethylpiperdine, 3,5 dimethylpiperidine, 3,5-dimethylpiperadine, acmc-1afvq, hexahydro-3,5-lutidine | |
| (3R,5S)-3,5-dimethylpiperidin-1-ium |
Safety and Handling
EINECSNumber : (5)-0769
TSCA : Yes