missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3,5-Dimethyl-p-anisic acid, 98%, Thermo Scientific™
$161.50 - $161.50
Chemical Identifiers
| CAS | 21553-46-8 |
|---|---|
| Molecular Formula | C10H12O3 |
| Molecular Weight (g/mol) | 180.2 |
| MDL Number | MFCD00020309 |
| InChI Key | WXVQURJGDUNJCS-UHFFFAOYSA-N |
| Synonym | 3,5-dimethyl-4-methoxybenzoic acid, 3,5-dimethyl-p-anisic acid, 4-methoxy-3,5-dimethyl-benzoic acid, 3,5-dimethyl anisic acid, benzoic acid, 4-methoxy-3,5-dimethyl, 4-methoxy-3,5-dimethylbenzoicacid, acmc-209flo, ksc496g8f, 3,5-dimethyl-4-methoxy-benzoic acid, 4-methoxy-3,5-dimethyl benzoic acid |
| PubChem CID | 88944 |
| IUPAC Name | 4-methoxy-3,5-dimethylbenzoic acid |
| SMILES | CC1=CC(=CC(=C1OC)C)C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC187130050
|
Thermo Scientific Chemicals
187130050 |
5 g | Glass bottle |
Each for $161.50
|
|
||||
Chemical Identifiers
| 21553-46-8 | |
| 180.2 | |
| WXVQURJGDUNJCS-UHFFFAOYSA-N | |
| 88944 | |
| CC1=CC(=CC(=C1OC)C)C(=O)O |
| C10H12O3 | |
| MFCD00020309 | |
| 3,5-dimethyl-4-methoxybenzoic acid, 3,5-dimethyl-p-anisic acid, 4-methoxy-3,5-dimethyl-benzoic acid, 3,5-dimethyl anisic acid, benzoic acid, 4-methoxy-3,5-dimethyl, 4-methoxy-3,5-dimethylbenzoicacid, acmc-209flo, ksc496g8f, 3,5-dimethyl-4-methoxy-benzoic acid, 4-methoxy-3,5-dimethyl benzoic acid | |
| 4-methoxy-3,5-dimethylbenzoic acid |
Specifications
| 21553-46-8 | |
| 100.0 | |
| White to Brown | |
| 98% | |
| C10H12O3 | |
| MFCD00020309 | |
| 3,5-dimethyl-4-methoxybenzoic acid, 3,5-dimethyl-p-anisic acid, 4-methoxy-3,5-dimethyl-benzoic acid, 3,5-dimethyl anisic acid, benzoic acid, 4-methoxy-3,5-dimethyl, 4-methoxy-3,5-dimethylbenzoicacid, acmc-209flo, ksc496g8f, 3,5-dimethyl-4-methoxy-benzoic acid, 4-methoxy-3,5-dimethyl benzoic acid | |
| CC1=CC(=CC(=C1OC)C)C(=O)O | |
| 180.2 | |
| 180.2 | |
| Crystalline Solid |
| 97.5 | |
| 190°C to 194°C | |
| Authentic | |
| Glass bottle | |
| CH3OC6H2(CH3)2CO2H | |
| 5 g | |
| WXVQURJGDUNJCS-UHFFFAOYSA-N | |
| 4-methoxy-3,5-dimethylbenzoic acid | |
| 88944 | |
| 98% | |
| 3, 5-Dimethyl-p-anisic acid, 98% |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
Wear protective gloves/protective clothing/eye protection/face protection.
GHS Signal Word: Warning
EINECSNumber : 244-441-9
TSCA : TSCA
RUO – Research Use Only