missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3,5-Dibromo-1,2-phenylenediamine Monohydrochloride 99.0+%, TCI America™
Sensitive reagent for the determination of Se by GC-ECD]
Supplier: TCI America A5080500MG
Specifications
| 3,5-Dibromo-1,2-phenylenediamine Monohydrochloride [Sensitive reagent for the determination of Se by | |
| Red-Yellow | |
| MFCD00012967 | |
| 3,5-dibromo-1,2-phenylenediamine monohydrochloride, 3,5-dibromobenzene-1,2-diamine hydrochloride, acmc-20andn, 1,2-diamino-3,5-dibromobenzene monohydrochloride, 3,5-bis bromanyl benzene-1,2-diamine hydrochloride, 3,5-dibromo-1,2-phenylenediamine hydrochloride, 1,2-benzenediamine,3,5-dibromo-, hydrochloride 1:1, 3,5-dibromo-ortho-phenylenediamine monohydrochloride, 3,5-dibromobenzene-1,2-diamine-hydrogen chloride 1/1, 3,5-dibromo-1,2-phenylenediaminemonohydrochloride sensitivereagentforthedeterminationofsebygc-ecd | |
| C1=C(C=C(C(=C1Br)N)N)Br.Cl | |
| 302.394 | |
| 302.39 | |
| Crystalline Powder |
| 75568-11-5 | |
| C6H7Br2ClN2 | |
| 500 mg | |
| QOZDVKFQMGARCC-UHFFFAOYSA-N | |
| 3,5-dibromobenzene-1,2-diamine;hydrochloride | |
| 2724285 | |
| ≥99.0% (T) |
Chemical Identifiers
| 75568-11-5 | |
| 302.394 | |
| QOZDVKFQMGARCC-UHFFFAOYSA-N | |
| 2724285 | |
| C1=C(C=C(C(=C1Br)N)N)Br.Cl |
| C6H7Br2ClN2 | |
| MFCD00012967 | |
| 3,5-dibromo-1,2-phenylenediamine monohydrochloride, 3,5-dibromobenzene-1,2-diamine hydrochloride, acmc-20andn, 1,2-diamino-3,5-dibromobenzene monohydrochloride, 3,5-bis bromanyl benzene-1,2-diamine hydrochloride, 3,5-dibromo-1,2-phenylenediamine hydrochloride, 1,2-benzenediamine,3,5-dibromo-, hydrochloride 1:1, 3,5-dibromo-ortho-phenylenediamine monohydrochloride, 3,5-dibromobenzene-1,2-diamine-hydrogen chloride 1/1, 3,5-dibromo-1,2-phenylenediaminemonohydrochloride sensitivereagentforthedeterminationofsebygc-ecd | |
| 3,5-dibromobenzene-1,2-diamine;hydrochloride |
Safety and Handling
TSCA : No
Recommended Storage : Refrigerator