Learn More
3,5-Bis(trifluoromethyl)benzenesulfonyl chloride, 97%
CAS: 39234-86-1 | C8H3ClF6O2S | 312.61 g/mol
$88.79 - $301.86
Chemical Identifiers
| CAS | 39234-86-1 |
|---|---|
| Molecular Formula | C8H3ClF6O2S |
| Molecular Weight (g/mol) | 312.61 |
| MDL Number | MFCD00014725 |
| InChI Key | BTRCVKADYDVSLI-UHFFFAOYSA-N |
| Synonym | 3,5-bis trifluoromethyl benzenesulfonyl chloride, 3,5-bis trifluoromethyl benzene-1-sulfonyl chloride, 3,5-bis trifluoromethyl benzenesulphonyl chloride, 3,5-di trifluoromethyl benzene-1-sulfonyl chloride, 3,5-ditrifluoromethylbenzenesulfonyl chloride, benzenesulfonyl chloride, 3,5-bis trifluoromethyl, 3,5-bis trifluoromethyl phenylsulfonyl chloride, 3,5-bis-trifluoromethyl-benzenesulfonyl chloride, 3,5-di trifluoromethyl benzene sulfonyl chloride, pubchem2724 |
| PubChem CID | 520945 |
| IUPAC Name | 3,5-bis(trifluoromethyl)benzenesulfonyl chloride |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)S(=O)(=O)Cl)C(F)(F)F |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1030003
|
Thermo Scientific Chemicals
A1030003 |
1 g |
Each for $88.79
|
|
|||||
|
AAA1030006
|
Thermo Scientific Chemicals
A1030006 |
5 g |
Each for $301.86
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 39234-86-1 | |
| 312.61 | |
| BTRCVKADYDVSLI-UHFFFAOYSA-N | |
| 520945 | |
| C1=C(C=C(C=C1C(F)(F)F)S(=O)(=O)Cl)C(F)(F)F |
| C8H3ClF6O2S | |
| MFCD00014725 | |
| 3,5-bis trifluoromethyl benzenesulfonyl chloride, 3,5-bis trifluoromethyl benzene-1-sulfonyl chloride, 3,5-bis trifluoromethyl benzenesulphonyl chloride, 3,5-di trifluoromethyl benzene-1-sulfonyl chloride, 3,5-ditrifluoromethylbenzenesulfonyl chloride, benzenesulfonyl chloride, 3,5-bis trifluoromethyl, 3,5-bis trifluoromethyl phenylsulfonyl chloride, 3,5-bis-trifluoromethyl-benzenesulfonyl chloride, 3,5-di trifluoromethyl benzene sulfonyl chloride, pubchem2724 | |
| 3,5-bis(trifluoromethyl)benzenesulfonyl chloride |
Specifications
| 39234-86-1 | |
| C8H3ClF6O2S | |
| 1 g | |
| 3621218 | |
| 3,5-bis trifluoromethyl benzenesulfonyl chloride, 3,5-bis trifluoromethyl benzene-1-sulfonyl chloride, 3,5-bis trifluoromethyl benzenesulphonyl chloride, 3,5-di trifluoromethyl benzene-1-sulfonyl chloride, 3,5-ditrifluoromethylbenzenesulfonyl chloride, benzenesulfonyl chloride, 3,5-bis trifluoromethyl, 3,5-bis trifluoromethyl phenylsulfonyl chloride, 3,5-bis-trifluoromethyl-benzenesulfonyl chloride, 3,5-di trifluoromethyl benzene sulfonyl chloride, pubchem2724 | |
| C1=C(C=C(C=C1C(F)(F)F)S(=O)(=O)Cl)C(F)(F)F | |
| 312.61 | |
| 312.61 | |
| 3,5-Bis (trifluoromethyl)benzenesulfonyl chloride |
| 34°C to 38°C | |
| MFCD00014725 | |
| UN3261 | |
| Moisture sensitive | |
| BTRCVKADYDVSLI-UHFFFAOYSA-N | |
| 3,5-bis(trifluoromethyl)benzenesulfonyl chloride | |
| 520945 | |
| 97% |
Safety and Handling
GHS H Statement
H314-H318
Causes severe skin burns and eye damage.
Causes serious eye damage.
P260-P264b-P271-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P501c
H314-H335
DOTInformation : Transport Hazard Class: 8; Packing Group: II; Proper Shipping Name: CORROSIVE SOLID, ACIDIC, ORGANIC, N.O.S.
EINECSNumber : 254-371-0
TSCA : No
Recommended Storage : Ambient temperatures
RUO – Research Use Only