Learn More
3,5-Bis(trifluoromethyl)aniline, 98+%
CAS: 328-74-5 | C8H5F6N | 229.12 g/mol
$88.70 - $280.97
Chemical Identifiers
| CAS | 328-74-5 |
|---|---|
| Molecular Formula | C8H5F6N |
| Molecular Weight (g/mol) | 229.12 |
| MDL Number | MFCD00000394 |
| InChI Key | CDIDGWDGQGVCIB-UHFFFAOYSA-N |
| Synonym | 3,5-bis trifluoromethyl aniline, 3,5-di trifluoromethyl aniline, benzenamine, 3,5-bis trifluoromethyl, 3,5-bis trifluoromethyl benzenamine, 3',5'-bis-trifluoromethyl aniline, 3,5-bis-trifluoromethylaniline, alpha,alpha,alpha,alpha',alpha',alpha'-hexafluoro-3,5-xylidine, 3,5-bis-trifluoromethyl-phenylamine, aniline, 3,5-bis trifluoromethyl |
| PubChem CID | 9480 |
| IUPAC Name | 3,5-bis(trifluoromethyl)aniline |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)N)C(F)(F)F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC185690100
|
Thermo Scientific Chemicals
185690100 |
10 mL | Glass bottle |
Each for $88.70
|
|
||||
|
AC185690500
|
Thermo Scientific Chemicals
185690500 |
50 mL | Glass bottle |
Each for $280.97
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 328-74-5 | |
| 229.12 | |
| CDIDGWDGQGVCIB-UHFFFAOYSA-N | |
| 9480 | |
| C1=C(C=C(C=C1C(F)(F)F)N)C(F)(F)F |
| C8H5F6N | |
| MFCD00000394 | |
| 3,5-bis trifluoromethyl aniline, 3,5-di trifluoromethyl aniline, benzenamine, 3,5-bis trifluoromethyl, 3,5-bis trifluoromethyl benzenamine, 3',5'-bis-trifluoromethyl aniline, 3,5-bis-trifluoromethylaniline, alpha,alpha,alpha,alpha',alpha',alpha'-hexafluoro-3,5-xylidine, 3,5-bis-trifluoromethyl-phenylamine, aniline, 3,5-bis trifluoromethyl | |
| 3,5-bis(trifluoromethyl)aniline |
Specifications
| 328-74-5 | |
| 100.0 | |
| 1.4700g/mL | |
| 83°C | |
| 98+% | |
| C8H5F6N | |
| (CF3)2C6H3NH2 | |
| 10 mL | |
| 3,5-bis trifluoromethyl aniline, 3,5-di trifluoromethyl aniline, benzenamine, 3,5-bis trifluoromethyl, 3,5-bis trifluoromethyl benzenamine, 3',5'-bis-trifluoromethyl aniline, 3,5-bis-trifluoromethylaniline, alpha,alpha,alpha,alpha',alpha',alpha'-hexafluoro-3,5-xylidine, 3,5-bis-trifluoromethyl-phenylamine, aniline, 3,5-bis trifluoromethyl | |
| C1=C(C=C(C=C1C(F)(F)F)N)C(F)(F)F | |
| 229.12 | |
| 229.12 | |
| Liquid |
| 98.0 | |
| Brown-Yellow to Yellow | |
| 85°C (15.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4330 to 1.435 | |
| MFCD00000394 | |
| 1.47 | |
| CDIDGWDGQGVCIB-UHFFFAOYSA-N | |
| 3,5-bis(trifluoromethyl)aniline | |
| 9480 | |
| 98+% | |
| 3, 5-Bis(trifluoromethyl)aniline |
Safety and Handling
GHS H Statement
Causes skin irritation.
Harmful if inhaled.
Harmful if swallowed.
Causes serious eye irritation.
Harmful in contact with skin.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
IF INHALED: Remov
GHS Signal Word: Warning
EINECSNumber : 206-335-
RUO – Research Use Only