Learn More
3,4-Diaminophenylboronic acid pinacol ester, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 444760010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 3, 4-Diaminophenylboronic acid pinacol ester | |
| 96% min. (GC) | |
| C12H19BN2O2 | |
| 1g | |
| SVUDHDDKOKWBNK-UHFFFAOYSA-N | |
| 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine | |
| 17750242 | |
| 97% |
| 851883-08-4 | |
| Glass Bottle | |
| MFCD09027073 | |
| 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzene-1,2-diamine, 3,4-diaminophenylboronic acid, pinacol ester, 3,4-diaminophenylboronic acid pinacol ester, pubchem22338, 4-4,4,5,5-tetramethyl-1,3,2 dioxaborolan-2-yl-benzene-1,2-diamine, 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-1,2-benzenediamine, 4-tetramethyl-1,3,2-dioxaborolan-2-yl benzene-1,2-diamine | |
| CC1(C)OB(OC1(C)C)C1=CC(N)=C(N)C=C1 | |
| 234.11 | |
| 234.11 |
Chemical Identifiers
| 851883-08-4 | |
| 234.11 | |
| SVUDHDDKOKWBNK-UHFFFAOYSA-N | |
| 17750242 | |
| CC1(C)OB(OC1(C)C)C1=CC(N)=C(N)C=C1 |
| C12H19BN2O2 | |
| MFCD09027073 | |
| 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzene-1,2-diamine, 3,4-diaminophenylboronic acid, pinacol ester, 3,4-diaminophenylboronic acid pinacol ester, pubchem22338, 4-4,4,5,5-tetramethyl-1,3,2 dioxaborolan-2-yl-benzene-1,2-diamine, 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-1,2-benzenediamine, 4-tetramethyl-1,3,2-dioxaborolan-2-yl benzene-1,2-diamine | |
| 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning
RUO â Research Use Only