Learn More
3,3',4,4'-Benzophenonetetracarboxylic dianhydride, 97+%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 401935000
| Quantity | 500g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 2421-28-5 | |
| 322.22 | |
| VQVIHDPBMFABCQ-UHFFFAOYSA-N | |
| 75498 | |
| C1=CC2=C(C=C1C(=O)C3=CC4=C(C=C3)C(=O)OC4=O)C(=O)OC2=O |
| C17H6O7 | |
| MFCD00005923 | |
| 3,3',4,4'-benzophenonetetracarboxylic dianhydride, benzophenonetetracarboxylic dianhydride, benzophenonetetracarboxylic acid dianhydride, 1,3-isobenzofurandione, 5,5'-carbonylbis, 4,4'-carbonylbis phthalic anhydride, 4,4'-carbonyldiphthalic anhydride, 4,4'-diphthalic anhydride ketone, benzophenonetetracarboxylic anhydride, phthalic anhydride, 4,4'-carbonyldi, unii-y61gva8097 | |
| 5-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-benzofuran-1,3-dione |
Specifications
| 3,3′,4,4′-Benzophenonetetracarboxylic dianhydride | |
| 2421-28-5 | |
| 100.0 | |
| 97+% | |
| C17H6O7 | |
| MFCD00005923 | |
| 0220.0°C | |
| VQVIHDPBMFABCQ-UHFFFAOYSA-N | |
| 5-(1,3-dioxo-2-benzofuran-5-carbonyl)-2-benzofuran-1,3-dione | |
| 75498 | |
| 97+% |
| 99% | |
| 98.5 | |
| Authentic | |
| Glass bottle | |
| 500g | |
| 3,3',4,4'-benzophenonetetracarboxylic dianhydride, benzophenonetetracarboxylic dianhydride, benzophenonetetracarboxylic acid dianhydride, 1,3-isobenzofurandione, 5,5'-carbonylbis, 4,4'-carbonylbis phthalic anhydride, 4,4'-carbonyldiphthalic anhydride, 4,4'-diphthalic anhydride ketone, benzophenonetetracarboxylic anhydride, phthalic anhydride, 4,4'-carbonyldi, unii-y61gva8097 | |
| Solubility in water: reacts. Other solubilities: soluble in dmf (1g/10mL) | |
| C1=CC2=C(C=C1C(=O)C3=CC4=C(C=C3)C(=O)OC4=O)C(=O)OC2=O | |
| 322.22 | |
| 322.22 |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present
GHS Signal Word: Warning
EINECSNumber : 219-348-1
TSCA : TSCA