Learn More
2-Phenoxybenzoic acid, 98%
CAS: 2243-42-7 | C13H10O3 | 214.22 g/mol
$32.66 - $441.33
Chemical Identifiers
| CAS | 2243-42-7 |
|---|---|
| Molecular Formula | C13H10O3 |
| Molecular Weight (g/mol) | 214.22 |
| MDL Number | MFCD00002429 |
| InChI Key | PKRSYEPBQPFNRB-UHFFFAOYSA-N |
| Synonym | o-phenoxybenzoic acid, benzoic acid, 2-phenoxy, benzoic acid, o-phenoxy, phenoxybenzoic acid, ortho-phenoxybenzoic acid, 2-phenoxybenzoicacid, 2-carboxydiphenyl ether, 2-phenoxy-benzoic acid, o-phenoxybenzoic acid, o-carboxydiphenyl ether |
| PubChem CID | 75237 |
| ChEBI | CHEBI:72636 |
| IUPAC Name | 2-phenoxybenzoic acid |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1051503
|
Thermo Scientific Chemicals
A1051503 |
1 g |
Each for $32.66
|
|
|||||
|
AAA1051514
|
Thermo Scientific Chemicals
A1051514 |
25 g |
Each for $140.18
|
|
|||||
|
AAA1051522
|
Thermo Scientific Chemicals
A1051522 |
100 g |
Each for $441.33
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 2243-42-7 | |
| 214.22 | |
| PKRSYEPBQPFNRB-UHFFFAOYSA-N | |
| 75237 | |
| 2-phenoxybenzoic acid |
| C13H10O3 | |
| MFCD00002429 | |
| o-phenoxybenzoic acid, benzoic acid, 2-phenoxy, benzoic acid, o-phenoxy, phenoxybenzoic acid, ortho-phenoxybenzoic acid, 2-phenoxybenzoicacid, 2-carboxydiphenyl ether, 2-phenoxy-benzoic acid, o-phenoxybenzoic acid, o-carboxydiphenyl ether | |
| CHEBI:72636 | |
| C1=CC=C(C=C1)OC2=CC=CC=C2C(=O)O |
Specifications
| 2243-42-7 | |
| C13H10O3 | |
| 1 g | |
| o-phenoxybenzoic acid, benzoic acid, 2-phenoxy, benzoic acid, o-phenoxy, phenoxybenzoic acid, ortho-phenoxybenzoic acid, 2-phenoxybenzoicacid, 2-carboxydiphenyl ether, 2-phenoxy-benzoic acid, o-phenoxybenzoic acid, o-carboxydiphenyl ether | |
| C1=CC=C(C=C1)OC2=CC=CC=C2C(=O)O | |
| 214.22 | |
| CHEBI:72636 | |
| 98% |
| 111°C to 115°C | |
| MFCD00002429 | |
| 978452 | |
| PKRSYEPBQPFNRB-UHFFFAOYSA-N | |
| 2-phenoxybenzoic acid | |
| 75237 | |
| 214.22 | |
| 2-Phenoxybenzoic acid |
Safety and Handling
GHS H Statement
H315-H319-H335
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P362-P501c
H315-H319-H335
EINECSNumber : 218-811-5
RTECSNumber : DH6293560
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only