Learn More
2-O-alpha-D-Glucopyranosyl-L-ascorbic acid, 98+%
CAS: 129499-78-1 | C12H18O11 | 338.265 g/mol
$55.36 - $191.51
Chemical Identifiers
| CAS | 129499-78-1 |
|---|---|
| Molecular Formula | C12H18O11 |
| Molecular Weight (g/mol) | 338.265 |
| MDL Number | MFCD23701380 |
| InChI Key | MLSJBGYKDYSOAE-DCWMUDTNSA-N |
| Synonym | l-ascorbic acid 2-glucoside, aa-2g, unii-2v52r0nhxw, 2-o-alpha-d-glucopyranosyl-l-ascorbic acid, 2v52r0nhxw, l-ascorbic acid-2-glucoside, ascorbic acid 2-o-glucoside, ascorbyl glucoside, l-ascorbic acid 2-o-alpha-glucoside, l-ascorbicacid2-glucoside |
| PubChem CID | 54693473 |
| ChEBI | CHEBI:81685 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-5-one |
| SMILES | C(C1C(C(C(C(O1)OC2=C(C(OC2=O)C(CO)O)O)O)O)O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAJ6660103
|
Thermo Scientific Chemicals
J6660103 |
1 g |
Each for $55.36
|
|
|||||
|
AAJ6660106
|
Thermo Scientific Chemicals
J6660106 |
5 g |
Each for $191.51
|
|
|||||
Description
2-O-alpha-D-Glucopyranosyl-L-ascorbic acid reduce the free radicals that result from UV irradiation of the skin, and significantly reduce cell damage and photo-aging. It also promotes collagen synthesis. It can function as an antioxidant.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Applications2-O-alpha-D-Glucopyranosyl-L-ascorbic acid reduce the free radicals that result from UV irradiation of the skin, and significantly reduce cell damage and photo-aging. It also promotes collagen synthesis. It can function as an antioxidant.
Solubility
Soluble in water. (879 g/L) at 25°C.
Notes
Store away from oxidizing agents. Store in a cool, dry conditions in a well sealed container.
Chemical Identifiers
| 129499-78-1 | |
| 338.265 | |
| MLSJBGYKDYSOAE-DCWMUDTNSA-N | |
| 54693473 | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-5-one |
| C12H18O11 | |
| MFCD23701380 | |
| l-ascorbic acid 2-glucoside, aa-2g, unii-2v52r0nhxw, 2-o-alpha-d-glucopyranosyl-l-ascorbic acid, 2v52r0nhxw, l-ascorbic acid-2-glucoside, ascorbic acid 2-o-glucoside, ascorbyl glucoside, l-ascorbic acid 2-o-alpha-glucoside, l-ascorbicacid2-glucoside | |
| CHEBI:81685 | |
| C(C1C(C(C(C(O1)OC2=C(C(OC2=O)C(CO)O)O)O)O)O)O |
Specifications
| 129499-78-1 | |
| White | |
| MFCD23701380 | |
| l-ascorbic acid 2-glucoside, aa-2g, unii-2v52r0nhxw, 2-o-alpha-d-glucopyranosyl-l-ascorbic acid, 2v52r0nhxw, l-ascorbic acid-2-glucoside, ascorbic acid 2-o-glucoside, ascorbyl glucoside, l-ascorbic acid 2-o-alpha-glucoside, l-ascorbicacid2-glucoside | |
| MLSJBGYKDYSOAE-DCWMUDTNSA-N | |
| (2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2H-furan-5-one | |
| 54693473 | |
| 338.26 | |
| Powder |
| 158°C to 163°C | |
| C12H18O11 | |
| 1 g | |
| Soluble in water. (879g/L) at 25°C. | |
| C(C1C(C(C(C(O1)OC2=C(C(OC2=O)C(CO)O)O)O)O)O)O | |
| 338.265 | |
| CHEBI:81685 | |
| 99.5% | |
| 2-O-alpha-D-Glucopyranosyl-L-ascorbic acid |
Safety and Handling
TSCA : No
Recommended Storage : Ambient temperatures
RUO – Research Use Only