Learn More
2-Naphthoyl chloride, 98%
CAS: 2243-83-6 | C11H7ClO | 190.626 g/mol
Supplier: Thermo Scientific Chemicals A1404618
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 2-Naphthoyl chloride | |
| 48°C to 52°C | |
| >110°C (230°F) | |
| C11H7ClO | |
| 50 g | |
| 907776 | |
| 2-naphthoyl chloride, 2-naphthalenecarbonyl chloride, 2-naphthoic chloride, 2-naphthoylchloride, beta-naphthoyl chloride, 2-napthoyl chloride, 2-chlorocarbonyl naphthalene, .beta.-naphthoyl chloride, .beta.-naphthalenecarbonyl chloride, beta-naphthalenecarbonyl chloride | |
| C1=CC=C2C=C(C=CC2=C1)C(=O)Cl | |
| 190.626 | |
| 190.63 |
| 2243-83-6 | |
| 159°C to 160°C (9 mmHg) | |
| Pungent | |
| MFCD00004093 | |
| UN3261 | |
| Moisture sensitive | |
| XNLBCXGRQWUJLU-UHFFFAOYSA-N | |
| naphthalene-2-carbonyl chloride | |
| 75246 | |
| 98% |
Chemical Identifiers
| 2243-83-6 | |
| 190.626 | |
| XNLBCXGRQWUJLU-UHFFFAOYSA-N | |
| 75246 | |
| C1=CC=C2C=C(C=CC2=C1)C(=O)Cl |
| C11H7ClO | |
| MFCD00004093 | |
| 2-naphthoyl chloride, 2-naphthalenecarbonyl chloride, 2-naphthoic chloride, 2-naphthoylchloride, beta-naphthoyl chloride, 2-napthoyl chloride, 2-chlorocarbonyl naphthalene, .beta.-naphthoyl chloride, .beta.-naphthalenecarbonyl chloride, beta-naphthalenecarbonyl chloride | |
| naphthalene-2-carbonyl chloride |
Safety and Handling
GHS H Statement
H314-H318
Causes severe skin burns and eye damage.
Causes serious eye damage.
P260-P264b-P271-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P501c
H314-H335
DOTInformation : Transport Hazard Class: 8; Packing Group: II; Proper Shipping Name: CORROSIVE SOLID, ACIDIC, ORGANIC, N.O.S.
EINECSNumber : 218-822-5
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only