Learn More
2-Naphthoic acid, 99%
CAS: 93-09-4 | C11H8O2 | 172.18 g/mol
$177.81 - $177.81
Chemical Identifiers
| CAS | 93-09-4 |
|---|---|
| Molecular Formula | C11H8O2 |
| Molecular Weight (g/mol) | 172.18 |
| MDL Number | MFCD00004101 |
| InChI Key | UOBYKYZJUGYBDK-UHFFFAOYSA-N |
| Synonym | 2-naphthoic acid, 2-naphthalenecarboxylic acid, isonaphthoic acid, 2-carboxynaphthalene, 2-maythic acid, beta-naphthoic acid, ne-2-carboxylic acid, unii-qlg01v0w2l, naphthalene-beta-carboxylic acid, .beta.-naphthoic acid |
| PubChem CID | 7123 |
| ChEBI | CHEBI:36106 |
| IUPAC Name | naphthalene-2-carboxylic acid |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC177320250
|
Thermo Scientific Chemicals
177320250 |
25 g | Glass bottle |
Each for $177.81
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 93-09-4 | |
| 172.18 | |
| UOBYKYZJUGYBDK-UHFFFAOYSA-N | |
| 7123 | |
| naphthalene-2-carboxylic acid |
| C11H8O2 | |
| MFCD00004101 | |
| 2-naphthoic acid, 2-naphthalenecarboxylic acid, isonaphthoic acid, 2-carboxynaphthalene, 2-maythic acid, beta-naphthoic acid, ne-2-carboxylic acid, unii-qlg01v0w2l, naphthalene-beta-carboxylic acid, .beta.-naphthoic acid | |
| CHEBI:36106 | |
| C1=CC=C2C=C(C=CC2=C1)C(=O)O |
Specifications
| 93-09-4 | |
| 100.0 | |
| White to Beige | |
| >300°C | |
| Authentic | |
| Glass bottle | |
| C10H7CO2H | |
| 25 g | |
| 15, 6467 | |
| Solubility in water: <0.5g/L (20°C). Other solubilities: soluble in alcohol and ether | |
| C1=CC=C2C=C(C=CC2=C1)C(=O)O | |
| 172.18 | |
| CHEBI:36106 | |
| 99% | |
| 2-Naphthoic acid |
| 98.5 | |
| 183°C to 187°C | |
| 205g/mL | |
| 205°C | |
| 98.5% min. (HPLC) | |
| C11H8O2 | |
| MFCD00004101 | |
| 09, 656 | |
| 2-naphthoic acid, 2-naphthalenecarboxylic acid, isonaphthoic acid, 2-carboxynaphthalene, 2-maythic acid, beta-naphthoic acid, ne-2-carboxylic acid, unii-qlg01v0w2l, naphthalene-beta-carboxylic acid, .beta.-naphthoic acid | |
| UOBYKYZJUGYBDK-UHFFFAOYSA-N | |
| naphthalene-2-carboxylic acid | |
| 7123 | |
| 172.18 | |
| Powder |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
GHS Signal Word: Warning
EINECSNumber : 202-217-8
RUO – Research Use Only