Learn More
2-Fluoro-4-methoxycarbonylphenylboronic acid, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 455870050
| Quantity | 5g |
|---|
Chemical Identifiers
| 603122-84-5 | |
| 197.96 | |
| 2-fluoro-4-methoxycarbonyl phenylboronic acid, 2-fluoro-4-methoxycarbonyl benzeneboronic acid, 4-methoxycarbonyl-2-fluorophenylboronic acid, 2-fluoro-4-methoxycarbonyl phenyl boronic acid, o-fluoro p-methoxy carbonyl phenyl boronic acid, pubchem17434, acmc-209mj4, 2-fluoro-4-methoxycarbonyl phenylboronicacid, 2-fluoro-4-methoxycarbonyl-phenylboronic acid | |
| (2-fluoro-4-methoxycarbonylphenyl)boronic acid |
| C8H8BFO4 | |
| BKWRLCIYMAYFPA-UHFFFAOYSA-N | |
| 24824345 | |
| B(C1=C(C=C(C=C1)C(=O)OC)F)(O)O |
Specifications
| 2-Fluoro-4-methoxycarbonylphenylboronic acid | |
| Authentic | |
| C8H8BFO4 | |
| 2-fluoro-4-methoxycarbonyl phenylboronic acid, 2-fluoro-4-methoxycarbonyl benzeneboronic acid, 4-methoxycarbonyl-2-fluorophenylboronic acid, 2-fluoro-4-methoxycarbonyl phenyl boronic acid, o-fluoro p-methoxy carbonyl phenyl boronic acid, pubchem17434, acmc-209mj4, 2-fluoro-4-methoxycarbonyl phenylboronicacid, 2-fluoro-4-methoxycarbonyl-phenylboronic acid | |
| B(C1=C(C=C(C=C1)C(=O)OC)F)(O)O | |
| 197.96 | |
| 197.96 |
| 603122-84-5 | |
| 97.5% min. (HPLC) | |
| 5g | |
| BKWRLCIYMAYFPA-UHFFFAOYSA-N | |
| (2-fluoro-4-methoxycarbonylphenyl)boronic acid | |
| 24824345 | |
| 98% |
Safety and Handling
GHS H Statement Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation.
GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Wash with plenty of soap and water. IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning