Learn More
2-Ethylhexyl acetate, 99%, pure, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 410105000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 2-Ethylhexyl acetate | |
| 103-09-3 | |
| 100.0 | |
| 197°C | |
| Authentic | |
| Glass bottle | |
| 1.4190 to 1.421 | |
| MFCD00027249 | |
| 0.87 | |
| acetic acid, 2-ethylhexyl ester, 2-ethyl-1-hexanol acetate, 2-ethylhexyl ethanoate, 2-ethyl-1-hexyl acetate, 2-ethylhexanyl acetate, 2-ethylhexylacetate, beta-ethylhexyl acetate, acetic acid 2-ethylhexyl ester, fema number 2806, 2-ethylhexylester kyseliny octove | |
| WOYWLLHHWAMFCB-UHFFFAOYNA-N | |
| 2-ethylhexyl acetate | |
| 7635 | |
| 172.27 | |
| Pure |
| 99% | |
| 98.5 | |
| 0.8700g/mL | |
| 71°C | |
| 99% | |
| C10H20O2 | |
| CH3COOCH2CH(C2H5)(CH2)3CH3 | |
| 500g | |
| 15, 6852 | |
| Solubility in water: insoluble | |
| CCCCC(CC)COC(C)=O | |
| 172.27 | |
| CHEBI:87392 | |
| 99% |
Chemical Identifiers
| 103-09-3 | |
| 172.27 | |
| WOYWLLHHWAMFCB-UHFFFAOYNA-N | |
| 7635 | |
| 2-ethylhexyl acetate |
| C10H20O2 | |
| MFCD00027249 | |
| acetic acid, 2-ethylhexyl ester, 2-ethyl-1-hexanol acetate, 2-ethylhexyl ethanoate, 2-ethyl-1-hexyl acetate, 2-ethylhexanyl acetate, 2-ethylhexylacetate, beta-ethylhexyl acetate, acetic acid 2-ethylhexyl ester, fema number 2806, 2-ethylhexylester kyseliny octove | |
| CHEBI:87392 | |
| CCCCC(CC)COC(C)=O |
Safety and Handling
GHS H Statement
Causes skin irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
Avoid breath
GHS Signal Word: Warning
EINECSNumber : 203-079-1
RUO â Research Use Only