missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals 2-Deoxy-D-glucose, 98+%, Thermo Scientific Chemicals
CAS: 154-17-6 | C6H12O5 | 164.16 g/mol
Supplier: Thermo Scientific Chemicals 111980250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 2-Deoxy-D-glucose | |
| 98.5 | |
| 146.0°C to 147.0°C | |
| 1% max. | |
| Authentic | |
| Glass bottle | |
| MFCD00151328 | |
| 15,2905 | |
| + 45.50 | |
| (2% in water) Clear colorless to light yellow | |
| OC[C@H]1OC(O)C[C@@H](O)[C@@H]1O | |
| 164.16 | |
| 164.16 | |
| Crystalline Powder or Crystals |
| 154-17-6 | |
| 100.0 | |
| White to Cream | |
| 1% max. | |
| 99% | |
| C6H12O5 | |
| 25 g | |
| + 45.50 (20.00°C c=2,H2O) | |
| deoxyglucose, 2-deoxy-d-mannose, 2-deoxy-d-arabinohexose, unii-9g2mp84a8w, d-arabino-hexose, 2-deoxy, arabino-hexose, 2-deoxy, d-glucose, 2-deoxy, 3r,4s,5r-3,4,5,6-tetrahydroxyhexanal, 2 deoxyglucose, 2 deoxy d glucose | |
| PMMURAAUARKVCB-PHUJZJCSNA-N | |
| (3S,4R,5S)-3,4,5,6-tetrahydroxyhexanal | |
| 17751002 | |
| 99% |
Chemical Identifiers
| 154-17-6 | |
| 164.16 | |
| PMMURAAUARKVCB-PHUJZJCSNA-N | |
| 17751002 | |
| OC[C@H]1OC(O)C[C@@H](O)[C@@H]1O |
| C6H12O5 | |
| MFCD00151328 | |
| deoxyglucose, 2-deoxy-d-mannose, 2-deoxy-d-arabinohexose, unii-9g2mp84a8w, d-arabino-hexose, 2-deoxy, arabino-hexose, 2-deoxy, d-glucose, 2-deoxy, 3r,4s,5r-3,4,5,6-tetrahydroxyhexanal, 2 deoxyglucose, 2 deoxy d glucose | |
| (3S,4R,5S)-3,4,5,6-tetrahydroxyhexanal |
Safety and Handling
EINECSNumber : 205-823-
RUO – Research Use Only