missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals 2-Deoxy-D-glucose, 98+%, Thermo Scientific Chemicals
CAS: 154-17-6 | C6H12O5 | 164.16 g/mol
$165.27 - $1927.72
Chemical Identifiers
| CAS | 154-17-6 |
|---|---|
| Molecular Formula | C6H12O5 |
| Molecular Weight (g/mol) | 164.16 |
| MDL Number | MFCD00151328 |
| InChI Key | PMMURAAUARKVCB-PHUJZJCSNA-N |
| Synonym | deoxyglucose, 2-deoxy-d-mannose, 2-deoxy-d-arabinohexose, unii-9g2mp84a8w, d-arabino-hexose, 2-deoxy, arabino-hexose, 2-deoxy, d-glucose, 2-deoxy, 3r,4s,5r-3,4,5,6-tetrahydroxyhexanal, 2 deoxyglucose, 2 deoxy d glucose |
| PubChem CID | 17751002 |
| IUPAC Name | (3S,4R,5S)-3,4,5,6-tetrahydroxyhexanal |
| SMILES | OC[C@H]1OC(O)C[C@@H](O)[C@@H]1O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC111980010
|
Thermo Scientific Chemicals
111980010 |
1 g | Glass bottle |
Each for $165.27
|
|
||||
|
AC111980050
|
Thermo Scientific Chemicals
111980050 |
5 g | Glass bottle |
Each for $532.61
|
|
||||
|
AC111980250
|
Thermo Scientific Chemicals
111980250 |
25 g | Glass bottle |
Each for $1,927.72
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 154-17-6 | |
| 164.16 | |
| PMMURAAUARKVCB-PHUJZJCSNA-N | |
| 17751002 | |
| OC[C@H]1OC(O)C[C@@H](O)[C@@H]1O |
| C6H12O5 | |
| MFCD00151328 | |
| deoxyglucose, 2-deoxy-d-mannose, 2-deoxy-d-arabinohexose, unii-9g2mp84a8w, d-arabino-hexose, 2-deoxy, arabino-hexose, 2-deoxy, d-glucose, 2-deoxy, 3r,4s,5r-3,4,5,6-tetrahydroxyhexanal, 2 deoxyglucose, 2 deoxy d glucose | |
| (3S,4R,5S)-3,4,5,6-tetrahydroxyhexanal |
Specifications
| 154-17-6 | |
| 100.0 | |
| White to Cream | |
| 1% max. | |
| 99% | |
| C6H12O5 | |
| 1 g | |
| + 45.50 | |
| (2% in water) Clear colorless to light yellow | |
| OC[C@H]1OC(O)C[C@@H](O)[C@@H]1O | |
| 164.16 | |
| 164.16 | |
| Crystalline Powder or Crystals |
| 98.5 | |
| 146.0°C to 147.0°C | |
| 1% max. | |
| Authentic | |
| Glass bottle | |
| MFCD00151328 | |
| 15,2905 | |
| deoxyglucose, 2-deoxy-d-mannose, 2-deoxy-d-arabinohexose, unii-9g2mp84a8w, d-arabino-hexose, 2-deoxy, arabino-hexose, 2-deoxy, d-glucose, 2-deoxy, 3r,4s,5r-3,4,5,6-tetrahydroxyhexanal, 2 deoxyglucose, 2 deoxy d glucose | |
| PMMURAAUARKVCB-PHUJZJCSNA-N | |
| (3S,4R,5S)-3,4,5,6-tetrahydroxyhexanal | |
| 17751002 | |
| 99% | |
| 2-Deoxy-D-glucose |
Safety and Handling
EINECSNumber : 205-823-
RUO – Research Use Only