missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Chloronitrobenzene 99.0+%, TCI America™
$26.54 - $99.54
Chemical Identifiers
| CAS | 88-73-3 |
|---|---|
| Molecular Formula | C6H4ClNO2 |
| Molecular Weight (g/mol) | 157.55 |
| MDL Number | MFCD00007061 |
| InChI Key | BFCFYVKQTRLZHA-UHFFFAOYSA-N |
| Synonym | 2-chloronitrobenzene, o-chloronitrobenzene, 2-nitrochlorobenzene, chloronitrobenzene, o-nitrochlorobenzene, benzene, 1-chloro-2-nitro, 2-chloro-1-nitrobenzene, oncb, benzene, chloronitro, nitrochlorobenzene |
| PubChem CID | 6945 |
| ChEBI | CHEBI:34270 |
| IUPAC Name | 1-chloro-2-nitrobenzene |
| SMILES | [O-][N+](=O)C1=CC=CC=C1Cl |
Chemical Identifiers
| 88-73-3 | |
| 157.55 | |
| BFCFYVKQTRLZHA-UHFFFAOYSA-N | |
| 6945 | |
| 1-chloro-2-nitrobenzene |
| C6H4ClNO2 | |
| MFCD00007061 | |
| 2-chloronitrobenzene, o-chloronitrobenzene, 2-nitrochlorobenzene, chloronitrobenzene, o-nitrochlorobenzene, benzene, 1-chloro-2-nitro, 2-chloro-1-nitrobenzene, oncb, benzene, chloronitro, nitrochlorobenzene | |
| CHEBI:34270 | |
| [O-][N+](=O)C1=CC=CC=C1Cl |
Specifications
| 88-73-3 | |
| 246°C | |
| MFCD00007061 | |
| 1578 | |
| BFCFYVKQTRLZHA-UHFFFAOYSA-N | |
| 1-chloro-2-nitrobenzene | |
| 6945 | |
| 157.55 | |
| Crystalline Lumps |
| Yellow | |
| C6H4ClNO2 | |
| 25 g | |
| 2-chloronitrobenzene, o-chloronitrobenzene, 2-nitrochlorobenzene, chloronitrobenzene, o-nitrochlorobenzene, benzene, 1-chloro-2-nitro, 2-chloro-1-nitrobenzene, oncb, benzene, chloronitro, nitrochlorobenzene | |
| [O-][N+](=O)C1=CC=CC=C1Cl | |
| 157.55 | |
| CHEBI:34270 | |
| ≥99.0% (GC) | |
| 2-Chloronitrobenzene |
Safety and Handling
EINECSNumber : (3)-0442
RTECSNumber : CZ0875000
TSCA : Yes