Learn More
2-Chloro-5-(trifluoromethyl)phenyl isocyanate, 97%
CAS: 50528-86-4 | C8H3ClF3NO | 221.563 g/mol
$48.38 - $118.11
Chemical Identifiers
| CAS | 50528-86-4 |
|---|---|
| Molecular Formula | C8H3ClF3NO |
| Molecular Weight (g/mol) | 221.563 |
| MDL Number | MFCD00037029 |
| InChI Key | WEPYOPYMWSHRIW-UHFFFAOYSA-N |
| Synonym | 2-chloro-5-trifluoromethyl phenyl isocyanate, 1-chloro-2-isocyanato-4-trifluoromethyl benzene, isocyanic acid 2-chloro-5-trifluoromethyl phenyl ester, 2-chloro-5-trifluoromethylphenyl isocyanate, 2-chloro-5-trifluoromethyl phenylisocyanate, 2-chloro-5-trifluoromethyl benzenisocyanate, pubchem5026, acmc-1aq1j, timtec-bb sbb006656, 1-mercapto-2-methyl-propan-2-ol |
| PubChem CID | 2733263 |
| IUPAC Name | 1-chloro-2-isocyanato-4-(trifluoromethyl)benzene |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N=C=O)Cl |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAL0989903
|
Thermo Scientific Chemicals
L0989903 |
1 g |
Each for $48.38
|
|
|||||
|
AAL0989906
|
Thermo Scientific Chemicals
L0989906 |
5 g |
Each for $118.11
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 50528-86-4 | |
| 221.563 | |
| WEPYOPYMWSHRIW-UHFFFAOYSA-N | |
| 2733263 | |
| C1=CC(=C(C=C1C(F)(F)F)N=C=O)Cl |
| C8H3ClF3NO | |
| MFCD00037029 | |
| 2-chloro-5-trifluoromethyl phenyl isocyanate, 1-chloro-2-isocyanato-4-trifluoromethyl benzene, isocyanic acid 2-chloro-5-trifluoromethyl phenyl ester, 2-chloro-5-trifluoromethylphenyl isocyanate, 2-chloro-5-trifluoromethyl phenylisocyanate, 2-chloro-5-trifluoromethyl benzenisocyanate, pubchem5026, acmc-1aq1j, timtec-bb sbb006656, 1-mercapto-2-methyl-propan-2-ol | |
| 1-chloro-2-isocyanato-4-(trifluoromethyl)benzene |
Specifications
| 50528-86-4 | |
| 52°C to 53°C (3 mmHg) | |
| C8H3ClF3NO | |
| MFCD00037029 | |
| UN2206 | |
| Moisture sensitive | |
| WEPYOPYMWSHRIW-UHFFFAOYSA-N | |
| 1-chloro-2-isocyanato-4-(trifluoromethyl)benzene | |
| 2733263 | |
| 97% |
| 1.48 | |
| 92°C (197°F) | |
| 1.489 | |
| 1 g | |
| 2112804 | |
| 2-chloro-5-trifluoromethyl phenyl isocyanate, 1-chloro-2-isocyanato-4-trifluoromethyl benzene, isocyanic acid 2-chloro-5-trifluoromethyl phenyl ester, 2-chloro-5-trifluoromethylphenyl isocyanate, 2-chloro-5-trifluoromethyl phenylisocyanate, 2-chloro-5-trifluoromethyl benzenisocyanate, pubchem5026, acmc-1aq1j, timtec-bb sbb006656, 1-mercapto-2-methyl-propan-2-ol | |
| C1=CC(=C(C=C1C(F)(F)F)N=C=O)Cl | |
| 221.563 | |
| 221.57 | |
| 2-Chloro-5-(trifluoromethyl)phenyl isocyanate |
Safety and Handling
GHS H Statement
H331-H334-H227-H302-H315-H319-H335
Toxic if inhaled.
May cause allergy or asthma symptoms or breathing difficulties if inhaled.
Combustible liquid.
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
P210-P235-P261-P264b-P270-P271-P280-P285-P301+P312-P302+P352-P304+P340-P305+P351+P338-P311-P330-P332+P313-P362-P370+P378q-P501c
H227-H302-H315-H319-H331-H334-H335
DOTInformation : Transport Hazard Class: 6.1; Packing Group: III; Proper Shipping Name: ISOCYANATES, TOXIC, N.O.S.
EINECSNumber : 000-000-0
TSCA : No
Recommended Storage : Keep cold
RUO – Research Use Only