Learn More
2-Chloro-3-nitropyridine, 99+%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 109731000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| 2-chloro-3-nitropyridine | |
| 99.0 | |
| 185g/mL | |
| Authentic | |
| Glass bottle | |
| 1.4540 to 1.4560 | |
| MFCD00006232 | |
| 20, I, 82 | |
| Solubility in water: insoluble | |
| C1=CC(=C(N=C1)Cl)[N+](=O)[O-] | |
| 158.54 | |
| 158.54 |
| 5470-18-8 | |
| 100.0 | |
| 185°C | |
| 99% min. (HPLC) | |
| C5H3ClN2O2 | |
| Cl(C5H3N)NO2 | |
| 100g | |
| pyridine, 2-chloro-3-nitro, 3-nitro-2-chloropyridine, 2-chloro-3-nitro-pyridine, 2-chloro-3-nitro pyridine, 2-chlor-3-nitropyridin, zlchem 303, pubchem1229, 2-chloro-nitropyridine, 2-chloro-3nitropyridine, 2-chloro3-nitropyridine | |
| UUOLETYDNTVQDY-UHFFFAOYSA-N | |
| 2-chloro-3-nitropyridine | |
| 79613 | |
| 99+% |
Chemical Identifiers
| 5470-18-8 | |
| 158.54 | |
| UUOLETYDNTVQDY-UHFFFAOYSA-N | |
| 79613 | |
| C1=CC(=C(N=C1)Cl)[N+](=O)[O-] |
| C5H3ClN2O2 | |
| MFCD00006232 | |
| pyridine, 2-chloro-3-nitro, 3-nitro-2-chloropyridine, 2-chloro-3-nitro-pyridine, 2-chloro-3-nitro pyridine, 2-chlor-3-nitropyridin, zlchem 303, pubchem1229, 2-chloro-nitropyridine, 2-chloro-3nitropyridine, 2-chloro3-nitropyridine | |
| 2-chloro-3-nitropyridine |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes serious eye irritation.
May cause respiratory irritation.
Causes skin irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
If skin irritation occurs: Get medical advice/attention.
If eye irritation persists: Get medical advice/attention.
GHS Signal Word: Warning
EINECSNumber : 226-799-8
RUO â Research Use Only