Learn More
2-Acrylamido-2-methylpropanesulfonic acid, 97%
CAS: 15214-89-8 | C7H13NO4S | 207.24 g/mol
Supplier: Thermo Scientific Chemicals 400290050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 2-Acrylamido-2-methylpropanesulfonic acid | |
| 96.0 | |
| 195.0°C | |
| 160°C | |
| 97% | |
| C7H13NO4S | |
| MFCD00007522 | |
| 2-acrylamido-2-methylpropanesulfonic acid, 2-acrylamido-2-methyl-1-propanesulfonic acid, 2-acrylamide-2-methylpropanesulfonic acid, 1-propanesulfonic acid, 2-methyl-2-1-oxo-2-propenyl amino, polyacrylamidomethylpropane sulfonic acid, unii-490hqe5ki5, 2-acrylamido-2-methylpropanesulfonate, 2-acrylamido-2-methylpropanesulphonic acid, 2-acrylamido-2-methylpropane sulfonic acid, 2-acrylamido-2-methylpropane-1-sulfonic acid | |
| XHZPRMZZQOIPDS-UHFFFAOYSA-N | |
| 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid | |
| 65360 | |
| 97% |
| 15214-89-8 | |
| 100.0 | |
| White | |
| Authentic | |
| Glass bottle | |
| CH2CHCONHC(CH3)2CH2SO3H | |
| 5 g | |
| Solubility in water: 1500g/L (20°C) | |
| CC(C)(CS(O)(=O)=O)NC(=O)C=C | |
| 207.24 | |
| 207.25 | |
| Powder, Chunks or Chips |
Chemical Identifiers
| 15214-89-8 | |
| 207.24 | |
| XHZPRMZZQOIPDS-UHFFFAOYSA-N | |
| 65360 | |
| CC(C)(CS(O)(=O)=O)NC(=O)C=C |
| C7H13NO4S | |
| MFCD00007522 | |
| 2-acrylamido-2-methylpropanesulfonic acid, 2-acrylamido-2-methyl-1-propanesulfonic acid, 2-acrylamide-2-methylpropanesulfonic acid, 1-propanesulfonic acid, 2-methyl-2-1-oxo-2-propenyl amino, polyacrylamidomethylpropane sulfonic acid, unii-490hqe5ki5, 2-acrylamido-2-methylpropanesulfonate, 2-acrylamido-2-methylpropanesulphonic acid, 2-acrylamido-2-methylpropane sulfonic acid, 2-acrylamido-2-methylpropane-1-sulfonic acid | |
| 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonic acid |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes serious eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
IF IN EYES:
GHS Signal Word: Danger
EINECSNumber : 239-268-
RUO – Research Use Only