missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2'-Acetonaphthone, 99%
CAS: 93-08-3 | C12H10O | 170.21 g/mol
$94.69 - $94.69
Chemical Identifiers
| CAS | 93-08-3 |
|---|---|
| Molecular Formula | C12H10O |
| Molecular Weight (g/mol) | 170.21 |
| MDL Number | MFCD00004108 |
| InChI Key | XSAYZAUNJMRRIR-UHFFFAOYSA-N |
| Synonym | 2-acetylnaphthalene, 2-acetonaphthone, 2'-acetonaphthone, methyl 2-naphthyl ketone, acetonaphthone, 1-naphthalen-2-yl ethanone, 1-2-naphthyl ethanone, ethanone, 1-2-naphthalenyl, oranger cyrstals, 2-naphthyl methyl ketone |
| PubChem CID | 7122 |
| ChEBI | CHEBI:52364 |
| IUPAC Name | 1-naphthalen-2-ylethanone |
| SMILES | CC(=O)C1=CC2=CC=CC=C2C=C1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC158881000
|
Thermo Scientific Chemicals
158881000 |
100 g |
Each for $94.69
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 93-08-3 | |
| 170.21 | |
| XSAYZAUNJMRRIR-UHFFFAOYSA-N | |
| 7122 | |
| 1-naphthalen-2-ylethanone |
| C12H10O | |
| MFCD00004108 | |
| 2-acetylnaphthalene, 2-acetonaphthone, 2'-acetonaphthone, methyl 2-naphthyl ketone, acetonaphthone, 1-naphthalen-2-yl ethanone, 1-2-naphthyl ethanone, ethanone, 1-2-naphthalenyl, oranger cyrstals, 2-naphthyl methyl ketone | |
| CHEBI:52364 | |
| CC(=O)C1=CC2=CC=CC=C2C=C1 |
Specifications
| 93-08-3 | |
| 100.0 | |
| White | |
| 168°C | |
| 98.5% min. (GC) | |
| C12H10O | |
| MFCD00004108 | |
| 07, 402 | |
| Solubility in water: insoluble | |
| CC(=O)C1=CC2=CC=CC=C2C=C1 | |
| 170.21 | |
| CHEBI:52364 | |
| 99% | |
| 2'-Acetonaphthone, 99% |
| 98.5 | |
| 53.0°C to 56.0°C | |
| 300.0°C to 301.0°C | |
| Authentic | |
| Plastic bottle | |
| C10H7COCH3 | |
| 100 g | |
| 2-acetylnaphthalene, 2-acetonaphthone, 2'-acetonaphthone, methyl 2-naphthyl ketone, acetonaphthone, 1-naphthalen-2-yl ethanone, 1-2-naphthyl ethanone, ethanone, 1-2-naphthalenyl, oranger cyrstals, 2-naphthyl methyl ketone | |
| XSAYZAUNJMRRIR-UHFFFAOYSA-N | |
| 1-naphthalen-2-ylethanone | |
| 7122 | |
| 170.21 | |
| Fine Crystalline Powder and Chunks |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
GHS Signal Word: Warning
EINECSNumber : 202-216-2
RTECSNumber : AL2988000
TSCA : TSCA
RUO – Research Use Only