missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,6-Pyridinedicarboxylic acid chloride, 97%, ACROS Organics™
$102.93 - $102.93
Chemical Identifiers
| CAS | 3739-94-4 |
|---|---|
| Molecular Formula | C7H3Cl2NO2 |
| Molecular Weight (g/mol) | 204.01 |
| MDL Number | MFCD00006289 |
| InChI Key | GWHOGODUVLQCEB-UHFFFAOYSA-N |
| Synonym | 2,6-pyridinedicarbony chloride |
| PubChem CID | 77335 |
| IUPAC Name | pyridine-2,6-dicarbonyl chloride |
| SMILES | C1=CC(=NC(=C1)C(=O)Cl)C(=O)Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC162130050 SDS |
Thermo Fisher Scientific
162130050 |
5g | Glass bottle |
Each for $102.93
|
|
AC162130250 SDS |
Thermo Fisher Scientific
162130250 |
25g | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
| AC162131000 SDS |
Thermo Fisher Scientific
AC162131000 |
100g | Glass bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 3739-94-4 | |
| 204.01 | |
| GWHOGODUVLQCEB-UHFFFAOYSA-N | |
| 77335 | |
| C1=CC(=NC(=C1)C(=O)Cl)C(=O)Cl |
| C7H3Cl2NO2 | |
| MFCD00006289 | |
| 2,6-pyridinedicarbony chloride | |
| pyridine-2,6-dicarbonyl chloride |
Specifications
| Authentic | |
| 284.0°C | |
| 57.0°C to 61.0°C | |
| 3739-94-4 | |
| 100.0 | |
| C7H3Cl2NO2 | |
| MFCD00006289 | |
| 2,6-pyridinedicarbony chloride | |
| C1=CC(=NC(=C1)C(=O)Cl)C(=O)Cl | |
| 204.01 | |
| 204.01 | |
| 97% |
| Glass bottle | |
| White to Brown | |
| 5g | |
| 96.0 | |
| 97% | |
| (C5H3N)(COCl)2 | |
| 22, 155 | |
| GWHOGODUVLQCEB-UHFFFAOYSA-N | |
| pyridine-2,6-dicarbonyl chloride | |
| 77335 | |
| Crystalline Powder, Crystals or Chunks | |
| 2, 6-Pyridinedicarboxylic acid chloride |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with wat
GHS Signal Word: Danger
EINECSNumber : 223-125-4