missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2,6-Dichlorobenzamide, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 161690250
| Quantity | 25g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| C7H5Cl2NO | |
| MFCD00007975 | |
| benzamide, 2,6-dichloro, 2,6-bam, unii-e9jwf529eb, 2,6-dichlorobenzoic acid amide, bam, e9jwf529eb, benzamide,6-dichloro, dsstox_cid_2170, acmc-209f5j, dsstox_rid_76511 | |
| CHEBI:28435 | |
| C1=CC(=C(C(=C1)Cl)C(=O)N)Cl |
Specifications
| 2, 6-Dichlorobenzamide | |
| 2008-58-4 | |
| 100.0 | |
| 96% min. (GC) | |
| C7H5Cl2NO | |
| 25g | |
| 09, I, 141 | |
| JHSPCUHPSIUQRB-UHFFFAOYSA-N | |
| 2,6-dichlorobenzamide | |
| 16183 | |
| 190.03 |
| 97% | |
| 96.0 | |
| Authentic | |
| Glass bottle | |
| Cl2C6H3CONH2 | |
| MFCD00007975 | |
| benzamide, 2,6-dichloro, 2,6-bam, unii-e9jwf529eb, 2,6-dichlorobenzoic acid amide, bam, e9jwf529eb, benzamide,6-dichloro, dsstox_cid_2170, acmc-209f5j, dsstox_rid_76511 | |
| C1=CC(=C(C(=C1)Cl)C(=O)N)Cl | |
| 190.03 | |
| CHEBI:28435 | |
| 97% |
Safety and Handling
EINECSNumber : 217-918-4
TSCA : TSCA