missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,6-Diaminoheptanedioic acid, 95%, ACROS Organics™
$63.57 - $228.26
Chemical Identifiers
| CAS | 583-93-7 |
|---|---|
| Molecular Formula | C7H14N2O4 |
| Molecular Weight (g/mol) | 190.2 |
| MDL Number | MFCD00002637 |
| InChI Key | GMKMEZVLHJARHF-UHFFFAOYSA-N |
| Synonym | 1,5-diaminoheptanedioic acid |
| PubChem CID | 865 |
| ChEBI | CHEBI:23673 |
| IUPAC Name | 2,6-diaminoheptanedioic acid |
| SMILES | C(CC(C(=O)O)N)CC(C(=O)O)N |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC235540010 SDS |
Thermo Fisher Scientific
235540010 |
1g | Glass bottle |
Each for $63.57
|
|
AC235540050 SDS |
Fisher Scientific Acros
235540050 |
5g | Glass bottle |
Each for $228.26
|
|
AC235540250 SDS |
Thermo Fisher Scientific
AC235540250 |
25g | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 583-93-7 | |
| 190.2 | |
| GMKMEZVLHJARHF-UHFFFAOYSA-N | |
| 865 | |
| 2,6-diaminoheptanedioic acid |
| C7H14N2O4 | |
| MFCD00002637 | |
| 1,5-diaminoheptanedioic acid | |
| CHEBI:23673 | |
| C(CC(C(=O)O)N)CC(C(=O)O)N |
Specifications
| Authentic | |
| White to Beige | |
| 1g | |
| 95.0 | |
| 95% | |
| HOOCCH(NH2)3(CH2)3CH(NH2)COOH | |
| 1,5-diaminoheptanedioic acid | |
| GMKMEZVLHJARHF-UHFFFAOYSA-N | |
| 2,6-diaminoheptanedioic acid | |
| 865 | |
| 190.2 | |
| 95% |
| Glass bottle | |
| 300°C | |
| 583-93-7 | |
| 100.0 | |
| C7H14N2O4 | |
| MFCD00002637 | |
| Solubility in water: 0.92% (21°C). Other solubilities: soluble in diluted acids and alkalies | |
| C(CC(C(=O)O)N)CC(C(=O)O)N | |
| 190.2 | |
| CHEBI:23673 | |
| Powder and/or Chunks | |
| 2, 6-Diaminoheptanedioic acid |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
GHS Signal Word: Warning
EINECSNumber : 209-524-6