Learn More
2,6-Di-tert-butyl-4-methylphenol, 99.8%
CAS: 128-37-0 | C15H24O | 220.35 g/mol
Supplier: Thermo Scientific Chemicals 219832500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 2, 6-Di-tert-butyl-4-methylphenol | |
| 128-37-0 | |
| 100.0 | |
| White | |
| 127°C | |
| 99.8% min. (GC) | |
| C15H24O | |
| MFCD00011644 | |
| 06,III,2073 | |
| 15,155 | |
| Solubility in water: insoluble. Other solubilities: freely soluble in toluene,soluble in methanol,ethanol,isopropanol,acetone,benzene,methyl ethyl ketone,petroleum ether,,cellowolve and most other hydrocarbon solvents | |
| CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C | |
| 220.35 | |
| 3.47 mm2/s (0°C) | |
| 220.35 | |
| Crystals |
| p.a. | |
| 99.75 | |
| 69.0°C to 71.0°C | |
| 265.0°C | |
| Authentic | |
| Plastic bottle | |
| [(CH3)3C]2C6H2(CH3)OH | |
| 250 g | |
| 15,113 | |
| 2,6-di-tert-butyl-4-methylphenol, butylated hydroxytoluene, butylhydroxytoluene, 2,6-di-tert-butyl-p-cresol, 2,6-di-t-butyl-4-methylphenol, ionol, dbpc, dibunol, stavox, bht | |
| NLZUEZXRPGMBCV-UHFFFAOYSA-N | |
| 2,6-ditert-butyl-4-methylphenol | |
| 31404 | |
| CHEBI:34247 | |
| 99.8% |
Chemical Identifiers
| 128-37-0 | |
| 220.35 | |
| NLZUEZXRPGMBCV-UHFFFAOYSA-N | |
| 31404 | |
| 2,6-ditert-butyl-4-methylphenol |
| C15H24O | |
| MFCD00011644 | |
| 2,6-di-tert-butyl-4-methylphenol, butylated hydroxytoluene, butylhydroxytoluene, 2,6-di-tert-butyl-p-cresol, 2,6-di-t-butyl-4-methylphenol, ionol, dbpc, dibunol, stavox, bht | |
| CHEBI:34247 | |
| CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
Safety and Handling
GHS H Statement
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Avoid release to the environment.
Collect spillage.
Dispose of contents/container to an approved waste disposal plant.
GHS Signal Word: Warning
EINECSNumber : 204-881-4
RTECSNumber : GO7875000
TSCA : TSCA
RUO – Research Use Only