missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2,5-Dimethyl-3-pyrroline, 75%, mixture of cis and trans, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 165930050
Specifications
| 2, 5-Dimethyl-3-pyrroline | |
| 59480-92-1 | |
| 100.0 | |
| 0.8240g/mL | |
| Authentic | |
| Glass bottle | |
| 1.4404 | |
| 5 g | |
| 2,5-dimethyl-3-pyrroline, 2,5-dimethyl-3-pyrroline, mixture of cis and trans, 2,5-dimethyl-2,5-dihydropyrrole, 1h-pyrrole,2,5-dihydro-2,5-dimethyl, 1h-pyrrole, 2,5-dihydro-2,5-dimethyl | |
| C[C@H]1[NH2+][C@@H](C)C=C1 | |
| 98.17 | |
| 97.16 | |
| Liquid |
| 75% | |
| 70.0 | |
| Colorless to Yellow | |
| 5°C | |
| 70% min. (GC) | |
| C6H12N | |
| MFCD00005215 | |
| 0.824 | |
| TXQDHQBSNAJSHQ-OLQVQODUSA-O | |
| 2,5-dimethyl-2,5-dihydro-1H-pyrrole | |
| 101066 | |
| 75% |
Chemical Identifiers
| 59480-92-1 | |
| 98.17 | |
| TXQDHQBSNAJSHQ-OLQVQODUSA-O | |
| 2,5-dimethyl-2,5-dihydro-1H-pyrrole |
| C6H12N | |
| MFCD00005215 | |
| 101066 | |
| C[C@H]1[NH2+][C@@H](C)C=C1 |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
Highly flammable liquid and vapor.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsi
GHS Signal Word: Danger
EINECSNumber : 261-781-3
TSCA : TSCA
RUO – Research Use Only