missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2,4,6-Triisopropylphenylboronic Acid (contains varying amounts of Anhydride), TCI America™
Supplier: TCI America T26545G
Specifications
| 2,4,6-Triisopropylphenylboronic Acid (contains varying amounts of Anhydride) | |
| 165°C | |
| C15H25BO2 | |
| 5 g | |
| FGFYEKLWZBTLEW-UHFFFAOYSA-N | |
| [2,4,6-tri(propan-2-yl)phenyl]boronic acid | |
| 15153544 | |
| Crystalline Powder |
| 154549-38-9 | |
| White | |
| MFCD02683099 | |
| 2,4,6-triisopropylphenyl boronic acid, 2,4,6-triisopropylphenylboronic acid, 2,4,6-triisopropylbenzeneboronic acid, 2,4,6-tri propan-2-yl phenyl boronic acid, 2,4,6-tris propan-2-yl phenyl boronic acid, acmc-209dav, 2,4,6-triisopropylphenyiboronic acid, 2,4,6-triisopropylphenyl boronicacid | |
| B(C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C)(O)O | |
| 248.173 | |
| 248.17 |
Chemical Identifiers
| 154549-38-9 | |
| 248.173 | |
| FGFYEKLWZBTLEW-UHFFFAOYSA-N | |
| 15153544 | |
| B(C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C)(O)O |
| C15H25BO2 | |
| MFCD02683099 | |
| 2,4,6-triisopropylphenyl boronic acid, 2,4,6-triisopropylphenylboronic acid, 2,4,6-triisopropylbenzeneboronic acid, 2,4,6-tri propan-2-yl phenyl boronic acid, 2,4,6-tris propan-2-yl phenyl boronic acid, acmc-209dav, 2,4,6-triisopropylphenyiboronic acid, 2,4,6-triisopropylphenyl boronicacid | |
| [2,4,6-tri(propan-2-yl)phenyl]boronic acid |
Safety and Handling
TSCA : No