missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2,3,5-Triphenyl Tetrazolium Chloride, MP Biomedicals
Supplier: MP Biomedicals Inc 0210312610
Description
- 2,3,5-Triphenyltetrazolium Chloride is commonly used in biochemical experiments especially to indicate cellular respiration
- TTC has been employed in autopsy pathology to assist identification of post-mortem myocardial infarctions
- Healthy viable heart muscle will stain deep red from the cardiac lactate dehydrogenase while areas of potential infarctions will be more pale
- Useful indicator for reducing substances
Specifications
| 2,3,5-TRIPHENYL TETRAZOLIUM CHLORIDE | |
| 243°C to 250°C (literature) | |
| C19H15ClN4 | |
| MFCD00011963 | |
| 2,3,5-triphenyltetrazolium chloride, tetrazolium red, uroscreen, red tetrazolium, urocheck, vitastain, tetrazolium chloride, triphenyltetrazolium chloride, 2,3,5-triphenyl-2h-tetrazolium chloride, tetrazolium chloride | |
| PKDBCJSWQUOKDO-UHFFFAOYSA-M | |
| triphenyl-3H-1,2λâµ,3,4-tetrazol-2-ylium chloride | |
| 9283 | |
| 334.8 |
| 298-96-4 | |
| White | |
| C19H15N4Cl | |
| 10 g | |
| Soluble in ethanol, alcohol, water (10mg/mL - clear, colorless solution) or acetone. Insoluble in ether. | |
| [Cl-].C1=CC=C(C=C1)N1N=C(N=[N+]1C1=CC=CC=C1)C1=CC=CC=C1 | |
| 334.81 | |
| CHEBI:78019 | |
| Powder |
Chemical Identifiers
| 298-96-4 | |
| 334.81 | |
| PKDBCJSWQUOKDO-UHFFFAOYSA-M | |
| 9283 | |
| triphenyl-3H-1,2λâµ,3,4-tetrazol-2-ylium chloride |
| C19H15ClN4 | |
| MFCD00011963 | |
| 2,3,5-triphenyltetrazolium chloride, tetrazolium red, uroscreen, red tetrazolium, urocheck, vitastain, tetrazolium chloride, triphenyltetrazolium chloride, 2,3,5-triphenyl-2h-tetrazolium chloride, tetrazolium chloride | |
| CHEBI:78019 | |
| [Cl-].C1=CC=C(C=C1)N1N=C(N=[N+]1C1=CC=CC=C1)C1=CC=CC=C1 |
Safety and Handling
Recommended Storage : +4°C, protect from light